BindingDB logo
myBDB logout

2 SMILES Strings for Aminoglycoside 2-O nucleotidyltransferase (ANT(2")-Ia)

Compound NameSMILES String
BDBM50189123 Clc1cc(Nc2ncnc3ccc(cc23)-c2ccc(CN3CCS(=O)CC3)o2)ccc1OCc1ccccc1
BDBM50189108 CS(=O)(=O)CCNCc1ccc(o1)-c1ccc2ncnc(Nc3ccc(OCc4ccccc4)c(Cl)c3)c2c1