BindingDB logo
myBDB logout

2 SMILES Strings for AmpC

Compound NameSMILES String
BDBM50240480 C[C@H]1[C@H](NC(=O)C(=N/OC(C)(C)C(O)=O)\c2csc(N)n2)C(=O)N1S(O)(=O)=O |r|
BDBM50327179 CC1(C)[C@H](NC(=O)C(=N/OCc2cc(=O)c(O)cn2O)\c2csc(N)n2)C(=O)N1OS(O)(=O)=O |r|