BindingDB logo
myBDB logout

1 SMILES String for Amylin receptor AMY3; CALCR/RAMP3

Compound NameSMILES String
BDBM50385309 C[C@]1(CNC2(CCCC2)C(=O)N1CC(=O)Nc1cnc2C[C@]3(Cc2c1)C(=O)Nc1ncccc31)c1cc(F)cc(F)c1 |r|