BindingDB logo
myBDB logout

9 SMILES Strings for Amyloid Binding Alcohol Dehydrogenase

Compound NameSMILES String
BDBM232923 COC(=O)c1cc(ccc1O)[C@H](Nc1nc2ccc(OC)cc2s1)P(=O)(OC)OC |r|
BDBM232924 COC(=O)c1cc(ccc1O)[C@H](Nc1nc2cc(F)ccc2s1)P(=O)(OC)OC |r|
BDBM232925 CCOP(=O)(OCC)[C@@H](Nc1nc2cc(OC)ccc2s1)c1ccc(O)c(c1)C(=O)OC |r|
BDBM232926 CCOP(=O)(OCC)[C@@H](Nc1nc2ccc(OC)cc2s1)c1ccc(O)c(c1)C(=O)OC |r|
BDBM232927 COc1ccc2nc(N[C@@H](c3ccc(O)cc3)P(=O)(OC)OC)sc2c1 |r|
BDBM232928 COc1ccc2nc(N[C@@H](c3ccccc3O)P(=O)(OC)OC)sc2c1 |r|
BDBM232929 COc1ccc2nc(N[C@@H](c3cccs3)P(=O)(OC)OC)sc2c1 |r|
BDBM232930 COc1ccc2nc(N[C@@H](c3ccc[nH]3)P(=O)(OC)OC)sc2c1 |r|
BDBM232931 COc1ccc2nc(N[C@@H](c3ccc(F)cc3)P(=O)(OC)OC)sc2c1 |r|