BindingDB logo
myBDB logout

8 SMILES Strings for Anaplastic lymphoma kinase C1156Y (ALK C1156Y)

Compound NameSMILES String
BDBM50306682 C[C@@H](Oc1cc(cnc1N)-c1cnn(c1)C1CCNCC1)c1c(Cl)ccc(F)c1Cl |r|
BDBM179799 CC(c1c(Cl)[nH]c2ncc(cc12)-c1cnn(c1)C1CCNCC1)c1c(Cl)ccc(F)c1Cl
BDBM179801 Fc1ccc(Cl)c(Sc2n[nH]c3ncc(cc23)-c2cnn(c2)C2CCNCC2)c1Cl
BDBM179802 Fc1ccc(Cl)c(c1Cl)C1(CC1)c1n[nH]c2ncc(cc12)-c1cnn(c1)C1CCNCC1
BDBM179803 CC(Oc1cc(cnc1N)-c1cnn(c1)C1CCNCC1)c1c(Cl)ccc(F)c1Cl
BDBM179804 CC(Sc1cc(cnc1N)-c1cnn(c1)C1CCNCC1)c1c(Cl)ccc(F)c1Cl
BDBM179798 CC(c1c(C)[nH]c2ncc(cc12)-c1cnn(c1)C1CCNCC1)c1c(Cl)ccc(F)c1Cl
BDBM179800 Fc1ccc(Cl)c(c1Cl)S(=O)c1c[nH]c2ncc(cc12)-c1cnn(c1)C1CCNCC1