BindingDB logo
myBDB logout

2 SMILES Strings for Androgen-induced gene 1 protein (AIG1)

Compound NameSMILES String
BDBM195604 CN(C)c1ccc(cc1)C(=O)N1CCN2C(C1)C(=O)N(OC(=O)N1CCC(CCc3ccc(Cl)cc3)CC1)C2=O