BindingDB logo
myBDB logout

22 SMILES Strings for Angiotensin IV

Compound NameSMILES String
BDBM82077 CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(O)=O)C(C)C)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1cnc[nH]1)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(C)=O |(1.13,.52,;1.58,1.99,;.53,3.12,;-.97,2.77,;.98,4.59,;2.48,4.94,;3.54,3.81,;3.08,2.34,;5.04,4.16,;5.49,5.63,;4.44,6.76,;2.93,6.41,;1.88,7.54,;2.33,9.01,;1.28,10.14,;3.84,9.36,;4.89,8.23,;6.09,3.03,;7.59,3.38,;8.04,4.85,;8.64,2.25,;10.14,2.6,;11.19,1.47,;10.74,-0,;12.69,1.82,;13.74,.69,;13.29,-.78,;14.34,-1.91,;13.89,-3.38,;12.39,-3.73,;11.94,-5.2,;11.34,-2.6,;13.14,3.29,;14.64,3.64,;15.69,2.51,;15.09,5.11,;14.04,6.24,;16.59,5.46,;17.04,6.93,;15.99,8.06,;18.54,7.28,;8.19,.78,;9.24,-.35,;6.69,.43,;-.07,5.72,;.38,7.19,;-1.57,5.37,;-2.62,6.5,;-2.17,7.97,;-3.22,9.1,;-2.92,10.61,;-4.27,11.35,;-5.4,10.3,;-4.75,8.91,;-4.12,6.15,;-4.57,4.68,;-5.17,7.28,;-6.67,6.93,;-6.64,5.39,;-7.96,4.6,;-9.38,5.2,;-10.39,4.04,;-9.6,2.72,;-8.1,3.06,;-7.72,8.06,;-7.27,9.53,;-9.22,7.71,;-10.38,8.72,;-11.7,7.93,;-11.36,6.43,;-9.82,6.29,;-10.42,4.87,;-10.87,3.4,;-11.95,4.69,;-12.55,3.27,;-14.08,3.08,;-14.68,1.66,;-13.76,.43,;-14.36,-.98,;-15.89,-1.17,;-16.81,.06,;-16.21,1.48,;-11.63,2.04,;-10.1,2.23,;-12.23,.62,)|
BDBM82258 CCCCc1nc(Cl)c(CO)n1Cc1ccc(cc1)-c1ccccc1-c1nnn[nH]1
BDBM85547 CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)C(C)C)C(=O)N[C@@H](Cc1cnc[nH]1)C(O)=O
BDBM85548 CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)C(C)C)C(=O)O[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C(=O)N[C@@H](CC(C)C)C(O)=O)c1cnc[nH]1 |r|
BDBM85549 CCCC[C@H](N)C(=O)N[C@H](Cc1ccccc1)C(=O)NCCCCCC(N)=O |r|
BDBM85550 CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)C(C)C)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(O)=O |r|
BDBM85551 CC[C@H](C)[C@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(O)=O |r|
BDBM85552 CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](N)C(C)C)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(O)=O |r|
BDBM85553 CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)C(C)C)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(O)=O
BDBM85554 CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@H](C)C(O)=O |wU:47.47,8.17,20.21,57.59,wD:4.4,24.32,35.36,2.2,(13.52,3.66,;12.19,2.89,;12.19,1.35,;13.52,.58,;10.85,.58,;10.85,-.96,;12.19,-1.73,;13.52,-.96,;12.19,-3.27,;10.85,-4.04,;10.85,-5.58,;9.52,-6.35,;9.52,-7.89,;10.85,-8.66,;10.85,-10.2,;12.19,-7.89,;12.19,-6.35,;13.52,-4.04,;14.85,-3.27,;14.85,-1.73,;16.19,-4.04,;17.52,-3.27,;18.85,-4.04,;18.85,-5.58,;20.19,-3.27,;20.19,-1.73,;21.52,-.96,;21.52,.58,;22.86,1.35,;22.86,2.89,;24.19,3.66,;21.52,3.66,;21.52,-4.04,;22.86,-3.27,;22.86,-1.73,;24.19,-4.04,;24.19,-5.58,;25.52,-3.27,;26.86,-4.04,;28.19,-3.27,;26.86,-5.58,;16.19,-5.58,;17.52,-6.35,;14.85,-6.35,;9.52,1.35,;8.18,.58,;9.52,2.89,;8.18,3.66,;6.85,2.89,;5.52,3.66,;5.36,5.19,;3.85,5.51,;3.08,4.18,;4.11,3.03,;8.18,5.2,;6.85,5.97,;9.52,5.97,;9.68,7.5,;11.17,7.9,;8.53,8.53,;8.86,10.04,;7.07,8.06,)|
BDBM85555 CCC(C)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)CNC)C(C)C)[C@@H](C)CC)C(O)=O |r,wU:15.23,29.40,45.55,8.7,4.4,wD:25.27,62.65,41.44,(10.06,-1.84,;10.29,-.31,;9.08,.65,;9.48,2.14,;7.67,.11,;6.47,1.08,;6.71,2.6,;8.11,3.15,;5.62,3.69,;5.8,5.15,;4.43,5.96,;3.31,4.85,;4.14,3.61,;3.43,2.23,;4.29,.93,;1.9,2.15,;1.06,3.43,;1.27,4.98,;2.66,5.69,;2.37,7.22,;.85,7.44,;.16,6.04,;1.17,.78,;-.37,.69,;-1.2,1.95,;-1.04,-.64,;-2.62,-.74,;-3.32,-2.12,;-2.48,-3.41,;-4.85,-2.21,;-5.68,-.94,;-5,.45,;-5.83,1.73,;-5.14,3.11,;-3.59,3.19,;-2.92,4.55,;-2.77,1.91,;-3.44,.52,;-5.56,-3.58,;-7.1,-3.68,;-7.93,-2.4,;-7.79,-5.05,;-9.33,-5.14,;-10.03,-6.51,;-9.18,-7.82,;-11.56,-6.61,;-12.41,-5.33,;-11.71,-3.93,;-12.55,-2.66,;-11.85,-1.26,;-12.71,.05,;-14.25,-.05,;-11.99,1.42,;-12.26,-7.97,;-11.17,-9.06,;-9.68,-8.66,;-11.57,-10.54,;-10.48,-11.63,;-10.88,-13.12,;-6.94,-6.35,;-5.41,-6.27,;-7.65,-7.73,;-.2,-1.94,;-.91,-3.35,;1.3,-1.86,;2.14,-3.15,;7.44,-1.42,;8.64,-2.4,;6.01,-1.98,)|
BDBM85556 CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(O)=O |wU:47.47,8.17,20.21,wD:4.4,24.32,35.36,60.63,2.2,(13.52,3.66,;12.19,2.89,;12.19,1.35,;13.52,.58,;10.85,.58,;10.85,-.96,;12.19,-1.73,;13.52,-.96,;12.19,-3.27,;10.85,-4.04,;10.85,-5.58,;9.52,-6.35,;9.52,-7.89,;10.85,-8.66,;10.85,-10.2,;12.19,-7.89,;12.19,-6.35,;13.52,-4.04,;14.85,-3.27,;14.85,-1.73,;16.19,-4.04,;17.52,-3.27,;18.85,-4.04,;18.85,-5.58,;20.19,-3.27,;20.19,-1.73,;21.52,-.96,;21.52,.58,;22.86,1.35,;22.86,2.89,;24.19,3.66,;21.52,3.66,;21.52,-4.04,;22.86,-3.27,;22.86,-1.73,;24.19,-4.04,;24.19,-5.58,;25.52,-3.27,;26.86,-4.04,;28.19,-3.27,;26.86,-5.58,;16.19,-5.58,;17.52,-6.35,;14.85,-6.35,;9.52,1.35,;8.18,.58,;9.52,2.89,;8.18,3.66,;6.85,2.89,;5.52,3.66,;5.36,5.19,;3.85,5.51,;3.08,4.18,;4.11,3.03,;8.18,5.2,;6.85,5.97,;9.52,5.97,;10.93,5.34,;11.96,6.49,;11.19,7.82,;9.68,7.5,;8.53,8.53,;8.86,10.04,;7.07,8.06,)|
BDBM85557 CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(C)C)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(O)=O |r,wU:39.39,8.17,24.25,52.55,56.58,wD:4.4,2.2,20.21,(2.14,-3.15,;1.3,-1.86,;-.2,-1.94,;-.91,-3.35,;-1.04,-.64,;-2.62,-.74,;-3.32,-2.12,;-2.48,-3.41,;-4.85,-2.21,;-5.68,-.94,;-5,.45,;-5.83,1.73,;-5.14,3.11,;-3.59,3.19,;-2.92,4.55,;-2.77,1.91,;-3.44,.52,;-5.56,-3.58,;-7.1,-3.68,;-7.93,-2.4,;-7.79,-5.05,;-9.33,-5.14,;-10.03,-6.51,;-9.18,-7.82,;-11.56,-6.61,;-12.26,-7.97,;-12.41,-5.33,;-11.71,-3.93,;-12.55,-2.66,;-11.85,-1.26,;-12.71,.05,;-14.25,-.05,;-11.99,1.42,;-6.94,-6.35,;-5.41,-6.27,;-7.65,-7.73,;-.37,.69,;-1.2,1.95,;1.17,.78,;1.9,2.15,;1.06,3.43,;1.27,4.98,;2.66,5.69,;2.37,7.22,;.85,7.44,;.16,6.04,;3.43,2.23,;4.29,.93,;4.14,3.61,;3.31,4.85,;4.43,5.96,;5.8,5.15,;5.62,3.69,;6.71,2.6,;8.11,3.15,;6.47,1.08,;7.67,.11,;9.08,.65,;10.29,-.31,;11.74,.25,;12.94,-.72,;12.71,-2.26,;11.27,-2.8,;10.06,-1.84,;7.44,-1.42,;8.64,-2.4,;6.01,-1.98,)|
BDBM85558 CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCN)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(O)=O |r|
BDBM85559 CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)CNC)C(C)C)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(C)O)C(O)=O |r,wU:44.44,8.17,24.32,57.60,61.63,wD:4.4,2.2,20.21,(2.14,-3.15,;1.3,-1.86,;-.2,-1.94,;-.91,-3.35,;-1.04,-.64,;-2.62,-.74,;-3.32,-2.12,;-2.48,-3.41,;-4.85,-2.21,;-5.68,-.94,;-5,.45,;-5.83,1.73,;-5.14,3.11,;-3.59,3.19,;-2.92,4.55,;-2.77,1.91,;-3.44,.52,;-5.56,-3.58,;-7.1,-3.68,;-7.93,-2.4,;-7.79,-5.05,;-9.33,-5.14,;-10.03,-6.51,;-9.18,-7.82,;-11.56,-6.61,;-12.41,-5.33,;-11.71,-3.93,;-12.55,-2.66,;-11.85,-1.26,;-12.71,.05,;-14.25,-.05,;-11.99,1.42,;-12.26,-7.97,;-11.17,-9.06,;-9.68,-8.66,;-11.57,-10.55,;-10.48,-11.63,;-10.88,-13.12,;-6.94,-6.35,;-5.41,-6.27,;-7.65,-7.74,;-.37,.69,;-1.2,1.95,;1.18,.78,;1.9,2.15,;1.06,3.43,;1.27,4.98,;2.66,5.69,;2.37,7.22,;.85,7.45,;.16,6.04,;3.43,2.23,;4.29,.93,;4.14,3.61,;3.32,4.85,;4.43,5.96,;5.8,5.15,;5.62,3.69,;6.71,2.6,;8.11,3.15,;6.47,1.08,;7.68,.11,;9.08,.65,;9.48,2.14,;10.3,-.31,;7.44,-1.42,;8.64,-2.4,;6.01,-1.98,)|
BDBM85542 CC(C)[C@H](N)CN[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CN[C@@H](Cc1cnc[nH]1)C(=O)CN1CCCC1C(=O)NC(C(O)=O)c1ccccc1)C(C)C |r|
BDBM85543 CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(C)C)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(O)=O |wU:39.39,8.17,20.21,wD:4.4,24.25,52.55,2.2,(13.52,3.66,;12.19,2.89,;12.19,1.35,;13.52,.58,;10.85,.58,;10.85,-.96,;12.19,-1.73,;13.52,-.96,;12.19,-3.27,;10.85,-4.04,;10.85,-5.58,;9.52,-6.35,;9.52,-7.89,;10.85,-8.66,;10.85,-10.2,;12.19,-7.89,;12.19,-6.35,;13.52,-4.04,;14.85,-3.27,;14.85,-1.73,;16.19,-4.04,;17.52,-3.27,;18.85,-4.04,;18.85,-5.58,;20.19,-3.27,;21.52,-4.04,;20.19,-1.73,;21.52,-.96,;21.52,.58,;22.86,1.35,;22.86,2.89,;24.19,3.66,;21.52,3.66,;16.19,-5.58,;17.52,-6.35,;14.85,-6.35,;9.52,1.35,;8.18,.58,;9.52,2.89,;8.18,3.66,;6.85,2.89,;5.52,3.66,;5.36,5.19,;3.85,5.51,;3.08,4.18,;4.11,3.03,;8.18,5.2,;6.85,5.97,;9.52,5.97,;10.93,5.34,;11.96,6.49,;11.19,7.82,;9.68,7.5,;8.53,8.53,;8.86,10.04,;7.07,8.06,)|
BDBM85544 CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)C(C)C)C(=O)O[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(C)C)C(O)=O)c1cnc[nH]1 |r|
BDBM85545 CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)C(C)C)C(O)=O
BDBM85546 CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)C(C)C)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C(O)=O)c1cnc[nH]1 |r|
BDBM50010361 Cc1cc(Cn2cnc3CN([C@@H](Cc23)C(O)=O)C(=O)C(c2ccccc2)c2ccccc2)ccc1N
BDBM50169147 CC(C)[C@H](N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(O)=O