BindingDB logo
myBDB logout

10 SMILES Strings for Angiotensin-converting enzyme-related carboxypeptidase

Compound NameSMILES String
BDBM50021026 CC(C)CC(NC(Cc1ccccc1)NP([O-])(=O)CNC(C)=O)C(O)=O
BDBM50021027 CC(C)CC(NC(Cc1ccccc1)NP([O-])(=O)CNC(=O)CCc1ccccc1)C(O)=O
BDBM50021029 CC(C)CC(NC(Cc1ccccc1)NP([O-])(=O)CNC(=O)c1ccccc1)C(O)=O
BDBM50021030 CC(C)CC(NC(=O)C(Cc1ccccc1)NP(C)([O-])=S)C([O-])=O
BDBM50021031 CC(C)CC(NC(Cc1ccccc1)NP([O-])(=O)CNC(=O)CNC(=O)C(N)Cc1ccc(O)cc1)C(O)=O
BDBM50021032 CSCCC(NC(Cc1ccccc1)NP([O-])(=O)CNC(C)=O)C(O)=O
BDBM50021033 CC(C)CC(NC(Cc1ccccc1)NP([O-])(=O)CNC(=O)[C@H](C)NC(=O)C(N)Cc1ccc(O)cc1)C(O)=O
BDBM50021034 CC(C)CC(NC(Cc1ccccc1)NP([O-])(=O)CNC(=O)Cc1ccccc1)C(O)=O
BDBM50367254 C[C@H](N[C@@H](CCc1ccccc1)C(O)=O)C(=O)N1CCC[C@H]1C(O)=O |r|
BDBM50367255 CCOP(=O)(CNC(C)=O)NC(Cc1ccccc1)NC(CCSC)C([O-])=O