BindingDB logo
myBDB logout

29 SMILES Strings for Anoctamin-1

Compound NameSMILES String
BDBM50387360 COc1ccc(cc1)-c1oc2ccc(OCc3cccc(F)c3)cc2c1C(O)=O
BDBM50387361 COc1ccc(cc1)-c1oc2ccc(OCc3cccc(I)c3)cc2c1C(O)=O
BDBM50387362 COc1ccc(cc1)-c1oc2ccc(OCc3ccc(Br)cc3)cc2c1C(O)=O
BDBM50387363 COc1ccc(cc1)-c1oc2ccc(OCc3cccc(Cl)c3)cc2c1C(O)=O
BDBM50387364 COc1ccc(cc1)-c1oc2ccc(OCc3c(F)cccc3F)cc2c1C(O)=O
BDBM50387365 COc1ccc(cc1)-c1oc2ccc(OCc3ccc(F)c(F)c3)cc2c1C(O)=O
BDBM50387366 COc1ccc(cc1)-c1oc2ccc(OCc3ccccc3Br)cc2c1C(O)=O
BDBM50387367 COc1ccc(cc1)-c1oc2ccc(OCc3cccc(c3)-c3ccccc3)cc2c1C(O)=O
BDBM50387368 Cc1ccc(cc1)-c1oc2ccc(OCc3cccc(F)c3)cc2c1C(O)=O
BDBM50387369 Cc1ccc(cc1)-c1oc2ccc(OCc3cccc(I)c3)cc2c1C(O)=O
BDBM50387370 Cc1ccc(cc1)-c1oc2ccc(OCc3ccc(Br)cc3)cc2c1C(O)=O
BDBM50387371 Cc1ccc(cc1)-c1oc2ccc(OCc3cccc(Cl)c3)cc2c1C(O)=O
BDBM50387372 Cc1ccc(cc1)-c1oc2ccc(OCc3c(F)cccc3F)cc2c1C(O)=O
BDBM50387373 Cc1ccc(cc1)-c1oc2ccc(OCc3cccc(c3)C(F)(F)F)cc2c1C(O)=O
BDBM50387374 Cc1ccc(cc1)-c1oc2ccc(OCc3ccc(F)c(F)c3)cc2c1C(O)=O
BDBM50387375 Cc1ccc(cc1)-c1oc2ccc(OCc3ccc(F)cc3)cc2c1C(O)=O
BDBM50387376 Cc1ccc(cc1)-c1oc2ccc(OCc3ccccc3Br)cc2c1C(O)=O
BDBM50387377 Cc1ccc(cc1)-c1oc2ccc(OCc3cccc(c3)-c3ccccc3)cc2c1C(O)=O
BDBM50387378 OC(=O)c1c(oc2ccc(OCc3cccc(F)c3)cc12)-c1ccc2ccccc2c1
BDBM50387379 OC(=O)c1c(oc2ccc(OCc3cccc(I)c3)cc12)-c1ccc2ccccc2c1
BDBM50387380 OC(=O)c1c(oc2ccc(OCc3ccc(Br)cc3)cc12)-c1ccc2ccccc2c1
BDBM50387381 OC(=O)c1c(oc2ccc(OCc3cccc(Cl)c3)cc12)-c1ccc2ccccc2c1
BDBM50387382 OC(=O)c1c(oc2ccc(OCc3c(F)cccc3F)cc12)-c1ccc2ccccc2c1
BDBM50387383 OC(=O)c1c(oc2ccc(OCc3cccc(c3)C(F)(F)F)cc12)-c1ccc2ccccc2c1
BDBM50387384 OC(=O)c1c(oc2ccc(OCc3ccc(F)cc3)cc12)-c1ccc2ccccc2c1
BDBM50387385 OC(=O)c1c(oc2ccc(OCc3ccccc3Br)cc12)-c1ccc2ccccc2c1
BDBM50387386 OC(=O)c1c(oc2ccc(OCc3cccc(c3)-c3ccccc3)cc12)-c1ccc2ccccc2c1
BDBM50387387 COc1ccc(cc1)-c1oc2ccc(OCc3ccc(F)cc3)cc2c1C(O)=O
BDBM50387388 OC(=O)c1c(oc2ccc(OCc3ccc(F)c(F)c3)cc12)-c1ccc2ccccc2c1