BindingDB logo
myBDB logout

8 SMILES Strings for Anthranilate phosphoribosyltransferase (Mtb-AnPRT)

Compound NameSMILES String
BDBM85513 Oc1ccccc1C([O-])=O
BDBM93077 COc1cccc2c1cc([N+]([O-])=O)c1c(cc3OCOc3c21)C([O-])=O
BDBM93073 [O-]C(=O)c1ccccc1Nc1ccccc1C([O-])=O
BDBM93074 Cc1cc(C)c(N)c(c1)C([O-])=O
BDBM93075 COc1cc(N)c(cc1OC)C([O-])=O
BDBM93076 [O-]C(=O)c1ccccc1Cc1ccccc1
BDBM93078 COc1ccc(cc1N)C([O-])=O
BDBM93079 NC(CCCNc1ccc(cc1N(=O)=O)[N+]([O-])=O)CC([O-])=O