BindingDB logo
myBDB logout

49 SMILES Strings for Apolipoprotein B-100

Compound NameSMILES String
BDBM50107810 Cc1cccc(C(=O)Nc2ccc3C[C@H](Cc3c2)NS(C)(=O)=O)c1-c1ccc(cc1)C(F)(F)F
BDBM50107811 COC(=O)NCC1Cc2ccc(NC(=O)c3cc(C)cc(C)c3-c3ccc(cc3)C(F)(F)F)cc2C1
BDBM50107812 COC(=O)N[C@H]1Cc2ccc(NC(=O)c3cccc(c3-c3ccc(cc3)C(F)(F)F)C(F)(F)F)cc2C1
BDBM50107813 COC(=O)N[C@H]1Cc2ccc(NC(=O)c3cccc(C)c3-c3ccc(cc3)C(F)(F)F)cc2C1 |r|
BDBM50107814 COC(=O)N[C@@H]1Cc2ccc(NC(=O)c3ccccc3-c3ccc(cc3)C(F)(F)F)cc2C1
BDBM50107815 Cc1cccc(C(=O)Nc2ccc3CC(CNS(=O)(=O)c4cccs4)Cc3c2)c1-c1ccc(cc1)C(F)(F)F
BDBM50107766 COC(=O)NCCC1Cc2ccc(NC(=O)c3cccc(C)c3-c3ccc(cc3)C(F)(F)F)cc2C1
BDBM50107767 COC(=O)NCC1Cc2ccc(NC(=O)c3cccc(C)c3-c3ccc(Cl)cc3)cc2C1
BDBM50107768 Cc1cccc(C(=O)Nc2ccc3CC(CNS(C)(=O)=O)Cc3c2)c1-c1ccc(Cl)cc1
BDBM50107769 CS(=O)(=O)NC1Cc2ccc(NC(=O)c3ccccc3-c3ccc(cc3)C(F)(F)F)cc2C1
BDBM50107770 Cc1cccc(C(=O)Nc2ccc3CC(Cc3c2)NS(=O)(=O)c2cccs2)c1-c1ccc(Cl)cc1
BDBM50107771 Cc1cccc(C(=O)Nc2ccc3CC(Cc3c2)NS(=O)(=O)c2ccccc2)c1-c1ccc(cc1)C#N
BDBM50107772 Cc1cccc(C(=O)Nc2ccc3CC(Cc3c2)NS(=O)(=O)c2cccs2)c1-c1ccc(F)cc1
BDBM50107773 Cc1cccc(C(=O)Nc2ccc3CCC(CCc3c2)NS(C)(=O)=O)c1-c1ccc(Cl)cc1
BDBM50107774 Cc1cc(C)c(-c2ccc(cc2)C(F)(F)F)c(c1)C(=O)Nc1ccc2C[C@H](Cc2c1)NS(=O)(=O)c1cccs1
BDBM50107775 COC(=O)N1CCN(CC1)[C@H]1Cc2ccc(NC(=O)c3cccc(C)c3-c3ccc(cc3)C(F)(F)F)cc2C1
BDBM50107776 FC(F)(F)c1ccc(cc1)-c1ccccc1C(=O)Nc1ccc2CC(Cc2c1)NCc1ccccc1
BDBM50107777 Cc1cc(C)c(-c2ccc(cc2)C(F)(F)F)c(c1)C(=O)Nc1ccc2C[C@@H](Cc2c1)NS(=O)(=O)c1cccs1
BDBM50107778 O=C(Nc1ccc2CC(Cc2c1)NS(=O)(=O)c1ccccc1)c1ccccc1-c1ccccc1
BDBM50107779 Cc1cccc(C(=O)Nc2ccc3CC(CNS(C)(=O)=O)Cc3c2)c1-c1ccc(cc1)C(F)(F)F
BDBM50107780 Cc1cccc(C(=O)Nc2ccc3C[C@@H](Cc3c2)NS(C)(=O)=O)c1-c1ccc(cc1)C(F)(F)F
BDBM50107781 Cc1ccc(cc1)-c1c(C)cccc1C(=O)Nc1ccc2CC(Cc2c1)NS(=O)(=O)c1ccccc1
BDBM50107782 Cc1cccc(C(=O)Nc2ccc3CC(Cc3c2)NS(C)(=O)=O)c1-c1ccc(Cl)cc1
BDBM50107783 COC(=O)NC1Cc2ccc(NC(=O)c3cc(C)cc(C)c3-c3ccc(Cl)cc3)cc2C1
BDBM50107784 Cc1cccc(C(=O)Nc2ccc3CC(Cc3c2)NS(C)(=O)=O)c1-c1ccc(F)cc1
BDBM50107785 COC(=O)NC1CCc2ccc(NC(=O)c3cc(C)cc(C)c3-c3ccc(cc3)C(F)(F)F)cc2CC1
BDBM50107787 Cc1cccc(C(=O)Nc2ccc3C[C@@H](Cc3c2)NCc2ccccn2)c1-c1ccc(cc1)C(F)(F)F |r|
BDBM50107788 COC(=O)N[C@H]1Cc2ccc(NC(=O)c3cc(C)ccc3-c3ccc(cc3)C(F)(F)F)cc2C1
BDBM50107789 COC(=O)N[C@@H]1Cc2ccc(NC(=O)c3cccc(C)c3-c3ccc(cc3)C(F)(F)F)cc2C1 |r|
BDBM50107790 FC(F)(F)c1ccc(cc1)-c1ccccc1C(=O)Nc1ccc2CC(Cc2c1)NS(=O)(=O)c1ccccc1
BDBM50107791 COc1cccc(C(=O)Nc2ccc3CC(Cc3c2)NS(C)(=O)=O)c1-c1ccc(Cl)cc1
BDBM50107792 Cc1cccc(C(=O)Nc2ccc3CC(Cc3c2)NS(=O)(=O)c2ccccc2)c1-c1ccc(Cl)cc1
BDBM50107793 COC(=O)N[C@@H]1Cc2ccc(NC(=O)c3cc(C)cc(C)c3-c3ccc(cc3)C(F)(F)F)cc2C1
BDBM50107794 COC(=O)N[C@H]1Cc2ccc(NC(=O)c3cc(ccc3-c3ccc(cc3)C(F)(F)F)C(F)(F)F)cc2C1
BDBM50107795 CN(C)C(=O)NC1Cc2ccc(NC(=O)c3ccccc3-c3ccc(cc3)C(F)(F)F)cc2C1
BDBM50107796 CC(=O)NC1Cc2ccc(NC(=O)c3ccccc3-c3ccc(cc3)C(F)(F)F)cc2C1
BDBM50107797 Cc1cccc(C(=O)Nc2ccc3CC(Cc3c2)NS(=O)(=O)c2ccccc2)c1-c1ccc(F)cc1
BDBM50107798 COC(=O)N[C@H]1Cc2ccc(NC(=O)c3ccccc3-c3ccc(cc3)C(F)(F)F)cc2C1
BDBM50107799 COC(=O)NCC1Cc2ccc(NC(=O)c3cccc(C)c3-c3ccc(cc3)C(F)(F)F)cc2C1
BDBM50107800 COC(=O)NC1CCc2ccc(NC(=O)c3cccc(C)c3-c3ccc(Cl)cc3)cc2CC1
BDBM50107801 FC(F)(F)c1ccc(cc1)-c1ccccc1C(=O)Nc1ccc2CC(Cc2c1)NC(=O)c1ccccc1
BDBM50107802 COc1cccc(C(=O)Nc2ccc3CC(Cc3c2)NS(=O)(=O)c2ccccc2)c1-c1ccc(Cl)cc1
BDBM50107803 Cc1cccc(C(=O)Nc2ccc3CCC(CCc3c2)NS(=O)(=O)c2cccs2)c1-c1ccc(cc1)C(F)(F)F
BDBM50107804 COC(=O)NC1CCc2ccc(NC(=O)c3cccc(C)c3-c3ccc(cc3)C(F)(F)F)cc2CC1
BDBM50107805 Cc1cccc(C(=O)Nc2ccc3CCC(CCc3c2)NS(C)(=O)=O)c1-c1ccc(cc1)C(F)(F)F
BDBM50107806 FC(F)(F)c1ccc(cc1)-c1ccccc1C(=O)Nc1ccc2C[C@@H](Cc2c1)NS(=O)(=O)c1ccccc1
BDBM50107807 COC(=O)N1CCN(CC1)[C@@H]1Cc2ccc(NC(=O)c3cccc(C)c3-c3ccc(cc3)C(F)(F)F)cc2C1
BDBM50107808 Cc1cccc(C(=O)Nc2ccc3C[C@H](Cc3c2)NS(=O)(=O)c2cccs2)c1-c1ccc(cc1)C(F)(F)F
BDBM50107809 COC(=O)N[C@H]1Cc2ccc(NC(=O)c3cc(C)cc(C)c3-c3ccc(cc3)C(F)(F)F)cc2C1