BindingDB logo
myBDB logout

20 SMILES Strings for Arabinose 5-phosphate isomerase

Compound NameSMILES String
BDBM50148790 O[C@H](COP(O)(O)=O)[C@@H](O)C([O-])=O
BDBM50322321 O[C@@H](COP(O)(O)=O)[C@H](O)[C@H](O)C(O)=O |r|
BDBM50405136 OC1OC(COP(O)(O)=O)C(F)C1O
BDBM50405137 O[C@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O |r|
BDBM50405138 Nc1ccc(cc1)S(=O)(=O)OC[C@H]1OC(=O)[C@H](O)[C@@H]1O |r|
BDBM50405139 OCC(O)C(O)C(O)CCP(O)(O)=O
BDBM50405140 OCC(F)C(O)C(O)COP(O)(O)=O
BDBM50405141 OCC(O)C(OCc1ccccc1)C(O)COP(O)(O)=O
BDBM50405142 OC(COP(O)(O)=O)C(F)C(O)C(O)=O
BDBM50405143 NS(=O)(=O)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H]1O |r|
BDBM50405144 OC(COP(O)(O)=O)C(O)C(F)C(O)=O
BDBM50405145 O[C@H]1O[C@H](COC(=O)NS([O-])(=O)=O)[C@@H](O)[C@@H]1O |r|
BDBM50405128 OCC(O)C(F)C(O)COP(O)(O)=O
BDBM50405129 ONCC(O)C(O)C(=O)COP(O)(O)=O
BDBM50405130 OCC(O)C(O)C(O)COP(O)(O)=O
BDBM50405131 OC1CC(COP(O)(O)=O)OC1O
BDBM50405132 CS(=O)(=O)OC[C@H]1OC(=O)[C@H](O)[C@@H]1O |r|
BDBM50405133 CC(=O)CC(=O)OC[C@H]1OC(=O)[C@H](O)[C@@H]1O |r|
BDBM50405134 COC1OC(COP(O)(O)=O)C(F)C1O
BDBM50405135 O[C@H]1[C@@H](O)C(=O)O[C@@H]1COS([O-])(=O)=O |r|