BindingDB logo
myBDB logout

3 SMILES Strings for Arabinosyltransferase A

Compound NameSMILES String
BDBM50215416 O[C@H]1[C@H](O)[C@@H](CN(CC2CCCCC2)CC2CCCCC2)O[C@@H]1CO[C@H]1O[C@H](CN(CC2CCCCC2)CC2CCCCC2)[C@@H](O)[C@@H]1O
BDBM50215417 O[C@H]1[C@H](O)[C@H](O[C@@H]1CN(CC1CCCCC1)CC1CCCCC1)\C=C\[C@H]1O[C@H](CN(CC2CCCCC2)CC2CCCCC2)[C@@H](O)[C@@H]1O
BDBM50215418 O[C@H]1[C@H](O)[C@@H](CN(CC2CCCCC2)CC2CCCCC2)O[C@@H]1CC[C@H]1O[C@H](CN(CC2CCCCC2)CC2CCCCC2)[C@@H](O)[C@@H]1O