BindingDB logo
myBDB logout

21 SMILES Strings for Arginase

Compound NameSMILES String
BDBM7462 Oc1ccc(cc1)-c1oc2cc(O)cc(O)c2c(=O)c1O
BDBM7460 Oc1cc(O)c2c(c1)oc(-c1ccc(O)c(O)c1)c(O)c2=O
BDBM15236 Oc1cc(O)c2c(c1)oc(-c1cc(O)c(O)c(O)c1)c(O)c2=O
BDBM23416 O[C@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1 |r|
BDBM23417 O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1 |r|
BDBM84978 C[C@@H]1O[C@@H](Oc2c(O)c3c(cc(O)cc3=O)oc2-c2ccc(O)c(O)c2)[C@H](O)[C@H](O)[C@H]1O
BDBM50241354 OC[C@H]1O[C@@H](Oc2c(O)c3c(cc(O)cc3=O)oc2-c2ccc(O)c(O)c2)[C@H](O)[C@@H](O)[C@@H]1O |r|
BDBM50349826 COc1cc(cc(OC)c1O)[C@H]1OC[C@H]2[C@@H]1CO[C@@H]2c1cc(OC)c(O)c(OC)c1 |r|
BDBM50350309 CC([NH3+])(CCCCB(O)O)C([O-])=O
BDBM50350310 [NH3+]C(CCCCB(O)O)(C(F)F)C([O-])=O
BDBM50350311 [NH3+][C@@H](CCCCB(O)O)C([O-])=O |r|
BDBM50404746 CC(=O)Oc1cc(OC(C)=O)c2c(c1)oc(-c1ccc(OC(C)=O)c(OC(C)=O)c1)c(OC(C)=O)c2=O
BDBM50446567 CC(=O)O[C@H]1[C@@H](Oc2cc(OC(C)=O)cc(OC(C)=O)c2C1=O)c1ccc(O)c(O)c1 |r|
BDBM50446568 C[C@H]1O[C@H](Oc2c(O)c3c(cc(O)cc3=O)oc2-c2cc(O)c(O)c(O)c2)[C@@H](O)[C@@H](O)[C@@H]1O |r|
BDBM50446569 COC1=Cc2c(cc(OC)c3cc(C)c(OC)cc23)C(C)(C)C1=O |t:2|
BDBM50446570 CC(=O)O[C@H]1[C@@H](Oc2cc(OC(C)=O)cc(OC(C)=O)c2C1=O)c1ccc(OC(C)=O)c(OC(C)=O)c1 |r|
BDBM50446571 CC(=O)O[C@H]1[C@@H](Oc2cc(O)cc(O)c2C1=O)c1ccc(O)c(O)c1 |r|
BDBM50446572 C[C@@H]1O[C@@H](O[C@H]2[C@@H](Oc3cc(O)cc(O)c3C2=O)c2ccc(O)cc2)[C@H](O)[C@H](O)[C@H]1O |r|
BDBM50446573 COc1cc(cc(OC)c1OC)-c1oc2cc(OC)c(OC)c(OC)c2c(=O)c1OC
BDBM50446574 COc1c(O)cc(cc1O)-c1oc2cc(O)cc(=O)c2c(O)c1O[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |r|
BDBM50446575 COc1ccc(cc1O)-c1oc2cc(O)cc(=O)c2c(O)c1O[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |r|