BindingDB logo
myBDB logout

5 SMILES Strings for Arginase (SmARG)

Compound NameSMILES String
BDBM50427900 N[C@](CCCCB(O)O)(CCN1CCCCC1)C(O)=O |r|
BDBM130378 N[C@@H](CCCCB(O)O)C(O)=O
BDBM130379 NC(=N)NCCC[C@H](NO)C(O)=O
BDBM130380 N\C(CCC[C@H]([NH3+])C([O-])=O)=[NH+]/O |r|
BDBM130381 N[C@](CCCCB(O)O)(C1CCN(Cc2ccc(Cl)c(Cl)c2)CC1)C(O)=O