BindingDB logo
myBDB logout

2 SMILES Strings for Arginyl-tRNA synthetase

Compound NameSMILES String
BDBM50091515 N[C@@H](CCCNC(N)=[NH2+])C(=O)NS(=O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1cnc2c(N)ncnc12
BDBM50091518 N[C@@H](CCCNC(N)=[NH2+])COP([O-])(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n1cnc2c(N)ncnc12