BindingDB logo
myBDB logout

6 SMILES Strings for Aromatase cytochrome P450

Compound NameSMILES String
BDBM13061 N#Cc1ccc(cc1)C(c1ccc(cc1)C#N)n1cncn1
BDBM85249 COc1ccc2C(CC(Oc2c1)c1cccc(O)c1)n1ccnc1
BDBM85250 COc1ccc2C(CC(Oc2c1)c1ccc(Cl)cc1)n1ccnc1
BDBM85251 COc1ccc2C(CC(Oc2c1)c1ccc(cc1)C#N)n1ccnc1
BDBM85252 COc1ccc2C(CC(Oc2c1)c1ccc(O)cc1)n1ccnc1
BDBM85253 Oc1ccc(cc1)C1CC(c2ccc(O)cc2O1)n1ccnc1