BindingDB logo
myBDB logout

15 SMILES Strings for Aromatic-L-amino-acid decarboxylase

Compound NameSMILES String
BDBM25524 COc1ccc2c(c[n+](C)c3c4cc5OCOc5cc4ccc23)c1OC
BDBM25525 C[n+]1cc2c3OCOc3ccc2c2ccc3cc4OCOc4cc3c12
BDBM50017565 [Cl-].C[n+]1cc2ccccc2c2ccccc12
BDBM50017568 [Cl-].COc1cc2c[n+](C)c3ccc(F)cc3c2cc1OC
BDBM50017570 [Cl-].COc1cc2c[n+](C)c3ccc(C)cc3c2cc1OC
BDBM50017571 [Cl-].COc1ccc2[n+](C)cc3cc(OC)c(OC)cc3c2c1
BDBM50017573 [Cl-].COc1ccc2c(c1)c[n+](C)c1ccc(F)cc21
BDBM50017575 [Cl-].COc1ccc2c(c1)c[n+](C)c1ccc(C)cc21
BDBM50017576 [Cl-].COc1ccc2c(c1)c[n+](C)c1ccc(OC)cc21
BDBM50017569 [Cl-].COc1cc2c[n+](C)c3ccc(Cl)cc3c2cc1OC
BDBM50017572 [Cl-].COc1ccc2c(c1)c[n+](C)c1ccccc21
BDBM50017574 [Cl-].COc1ccc2c(c1)c[n+](C)c1ccc(Cl)cc21
BDBM50017577 [Cl-].COc1ccc2c(c1)c[n+](C)c1ccc(O)cc21
BDBM50017566 COc1cc2c[n+](C)c3c(ccc4cc5OCOc5cc34)c2cc1OC
BDBM50017567 [Cl-].COc1cc2c[n+](C)c3ccccc3c2cc1OC