BindingDB logo
myBDB logout

1 SMILES String for Arrestin, beta 1

Compound NameSMILES String
BDBM34233 O=c1n([se]c2ccccc12)-c1ccccc1