BindingDB logo
myBDB logout

25 SMILES Strings for Aryl Hydrocarbon Receptor (AhR)

Compound NameSMILES String
BDBM23939 COc1cccc(\C=C\c2cc(Cl)cc(Cl)c2)c1
BDBM23940 COc1ccc(\C=C/c2cc(OC)cc(OC)c2)cc1
BDBM23941 Clc1ccc(\C=C/c2cc(Cl)cc(Cl)c2)cc1
BDBM23942 COc1ccc(\C=C/c2cc(F)cc(F)c2)cc1
BDBM23943 Fc1ccc(\C=C/c2cc(F)cc(F)c2)cc1
BDBM23944 FC(F)(F)c1ccc(\C=C/c2cc(cc(c2)C(F)(F)F)C(F)(F)F)cc1
BDBM23946 CCOc1ccc(\C=C/c2cc(OC)cc(OC)c2)cc1
BDBM23947 CCCCOc1ccc(\C=C/c2cc(OC)cc(OC)c2)cc1
BDBM23945 COc1cc(OC)cc(\C=C/c2ccc(F)cc2)c1
BDBM23948 FC(F)(F)c1ccc(\C=C/c2cc(Cl)cc(Cl)c2)cc1
BDBM23949 COc1ccc(\C=C/c2cc(Cl)cc(Cl)c2)cc1
BDBM23950 FC(F)(F)c1cccc(\C=C/c2cc(Cl)cc(Cl)c2)c1
BDBM23951 COc1cccc(\C=C/c2cc(Cl)cc(Cl)c2)c1
BDBM23926 Oc1ccc(\C=C\c2cc(O)cc(O)c2)cc1
BDBM23928 COc1ccc(\C=C\c2cc(OC)cc(OC)c2)cc1
BDBM23929 Clc1ccc(\C=C\c2cc(Cl)cc(Cl)c2)cc1
BDBM23930 COc1ccc(\C=C\c2cc(F)cc(F)c2)cc1
BDBM23931 Fc1ccc(\C=C\c2cc(F)cc(F)c2)cc1
BDBM23932 FC(F)(F)c1ccc(\C=C\c2cc(cc(c2)C(F)(F)F)C(F)(F)F)cc1
BDBM23934 CCOc1ccc(\C=C\c2cc(OC)cc(OC)c2)cc1
BDBM23935 CCCCOc1ccc(\C=C\c2cc(OC)cc(OC)c2)cc1
BDBM23933 COc1cc(OC)cc(\C=C\c2ccc(F)cc2)c1
BDBM23936 FC(F)(F)c1ccc(\C=C\c2cc(Cl)cc(Cl)c2)cc1
BDBM23937 COc1ccc(\C=C\c2cc(Cl)cc(Cl)c2)cc1
BDBM23938 FC(F)(F)c1cccc(\C=C\c2cc(Cl)cc(Cl)c2)c1