BindingDB logo
myBDB logout

2 SMILES Strings for Arylacetamide deacetylase

Compound NameSMILES String
BDBM50131270 CC(C)C(=O)Nc1ccc(c(c1)C(F)(F)F)[N+]([O-])=O
BDBM50370232 CO[C@H]1\C=C\O[C@@]2(C)Oc3c(C2=O)c2c(O)c(\C=N\N4CCN(C)CC4)c(NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C)c(O)c2c(O)c3C |r,c:33,t:3,35|