BindingDB logo
myBDB logout

4 SMILES Strings for Arylsulfatase

Compound NameSMILES String
BDBM50098109 NS(=O)(=O)Oc1cccc(c1)[N+]([O-])=O
BDBM50400983 [NH3+]CCOCCOCCNC(=O)C(F)c1ccc(OS([O-])(=O)=O)cc1
BDBM50400984 OS(=O)(=O)Oc1ccccc1C(F)F
BDBM50400985 OS(=O)(=O)Oc1ccc(cc1)C(F)F