BindingDB logo
myBDB logout

8 SMILES Strings for Asialoglycoprotein receptor 1

Compound NameSMILES String
BDBM50077229 OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O |r|
BDBM50240803 OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |r|
BDBM50304486 CC(=O)N[C@H]1C(OC(C)=O)O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |r|
BDBM50304487 COC[C@H]1O[C@@H](OC)[C@H](OC)[C@@H](OC)[C@H]1OC |r|
BDBM50304488 COC[C@H]1O[C@H](OC)[C@H](OC)[C@@H](OC)[C@H]1OC |r|
BDBM50074089 [H][C@@]12CC[C@H](C(C)CCCC(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@H](CC[C@]12C)OC(=O)CNC(=O)CCCCC(=O)NCC(=O)NC(COCOCCOCCOCCOCCO[C@@H]1O[C@@H](CO)[C@H](O)[C@H](O)[C@@H]1O)(COCOCCOCCOCCOCCO[C@@H]1O[C@@H](CO)[C@H](O)[C@H](O)[C@@H]1O)COCOCCOCCOCCOCCO[C@@H]1O[C@@H](CO)[C@H](O)[C@H](O)[C@@H]1O |t:24|
BDBM50074090 OC[C@@H]1O[C@@H](OCCCCC(=O)NCCCNC(=O)CCOCC(COCCC(=O)NCCCNC(=O)CCCCO[C@@H]2O[C@@H](CO)[C@H](O)[C@H](O)[C@@H]2O)(COCCC(=O)NCCCNC(=O)CCCCO[C@@H]2O[C@@H](CO)[C@H](O)[C@H](O)[C@@H]2O)NC(=O)CNC(=O)OCc2ccccc2)[C@@H](O)[C@@H](O)[C@H]1O
BDBM50074091 OC[C@@H]1O[C@@H](OCCCCC(=O)NCC(=O)NCCCC(=O)OCC(COC(=O)CCCNC(=O)CNC(=O)CCCCO[C@@H]2O[C@@H](CO)[C@H](O)[C@H](O)[C@@H]2O)(COC(=O)CCCNC(=O)CNC(=O)CCCCO[C@@H]2O[C@@H](CO)[C@H](O)[C@H](O)[C@@H]2O)NC(=O)CNC(=O)OCc2ccccc2)[C@@H](O)[C@@H](O)[C@H]1O