BindingDB logo
myBDB logout

1 SMILES String for Aspartase

Compound NameSMILES String
BDBM50297823 OC(=O)[C@H]1N[C@@H]1C(O)=O |r|