BindingDB logo
myBDB logout

8 SMILES Strings for Aspartyl aminopeptidase

Compound NameSMILES String
BDBM50008427 CC(C)C[C@H](N)C(=O)CC(C)C(O)=O
BDBM50008428 CC(C)CCNC(=O)[C@@H](O)[C@H](N)CC(C)C
BDBM50008429 CC(C)C[C@H](N)C(C)=O
BDBM50008430 CC(C)CCNC(=O)C(=O)C(N)Cc1ccccc1
BDBM50008431 CC(C)CCNC(=O)[C@@H](O)[C@H](N)Cc1ccccc1
BDBM50008432 CC(C)CCNC(=O)C(=O)[C@H](N)CC(C)C
BDBM50008433 CC(C)CCNC(=O)C(=O)[C@@H](N)CC(C)C
BDBM50008434 CC(C)C[C@H](N)C(=O)CC(Cc1ccccc1)C(O)=O