BindingDB logo
myBDB logout

12 SMILES Strings for Atrial natriuretic factor

Compound NameSMILES String
BDBM50085452 CS(=O)(=O)N[C@@H](CCCCN)C(=O)NC[C@H](CC1(CCCC1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(O)=O)C(O)=O
BDBM50344187 CC(C)CC[C@H](N[C@@H](CCc1ccccc1)C(O)=O)C(=O)N[C@@H](Cc1ccc(cc1)-c1ccccc1)C(O)=O |r|
BDBM50344188 CCC[C@H](NC1(CCCC1)C(=O)N[C@@H](Cc1nc(CC)co1)C(O)=O)C(O)=O |r|
BDBM50344189 CCC[C@H](NC1(CCCC1)C(=O)N[C@@H](Cc1nc(CC(C)C)co1)C(O)=O)C(O)=O |r|
BDBM50344190 CCC[C@H](NC1(CCCC1)C(=O)N[C@@H](Cc1nc(co1)-c1ccccc1)C(O)=O)C(O)=O |r|
BDBM50344191 CCC[C@H](NC1(CCCC1)C(=O)N[C@@H](Cc1ncc(o1)-c1ccccc1)C(O)=O)C(O)=O |r|
BDBM50344192 COCC[C@H](NC1(CCCC1)C(=O)N[C@@H](Cc1nc(co1)-c1ccccc1)C(O)=O)C(O)=O |r|
BDBM50344193 COCC[C@H](NC1(CCCC1)C(=O)N[C@@H](Cc1ncc(o1)-c1ccccc1)C(O)=O)C(O)=O |r|
BDBM50344194 COCC[C@H](NC1(CCCC1)C(=O)N[C@@H](Cc1nc(C)c(o1)-c1ccccc1)C(O)=O)C(O)=O |r|
BDBM50344195 COCC[C@H](NC1(CCCC1)C(=O)N[C@@H](Cc1ncc(o1)-c1ccc(Cl)cc1)C(O)=O)C(O)=O |r|
BDBM50344196 COCC[C@H](NC1(CCCC1)C(=O)N[C@@H](Cc1nnc(o1)-c1ccccc1)C(O)=O)C(O)=O |r|
BDBM50344197 COCC[C@H](NC1(CCCC1)C(=O)N[C@@H](Cc1nc(no1)-c1ccccc1)C(O)=O)C(O)=O |r|