BindingDB logo
myBDB logout

28 SMILES Strings for Atrial natriuretic peptide receptor

Compound NameSMILES String
BDBM50091751 CC[C@H](C)[C@@H]1NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)CNC(=O)CNC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](N)CSSC[C@@H](NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)CNC1=O)C(O)=O)[C@@H](C)CC
BDBM50091752 CC[C@H](C)CNC(=O)[C@H](C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)Cc1ccc(NC(=O)c2ccc3ccccc3c2)cc1)[C@@H](C)CC
BDBM50091753 CC[C@H](C)[C@@H]1NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCCNC(N)=N)NC(=O)CNC(=O)CNC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](CSSC[C@@H](NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)CNC1=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](Cc1ccc(O)cc1)C(O)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CO
BDBM50091754 CC[C@H](C)[C@@H]1NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)CNC(=O)CNC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](CSSC[C@@H](NC(=O)[C@H](C)NC(=O)CNC1=O)C(O)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CCCNC(N)=N)[C@@H](C)CC
BDBM50091755 CCC[C@H](C)CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)Cc1ccccc1)[C@@H](C)CC
BDBM50091756 CCC[C@H](C)CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(C)=O)[C@@H](C)CC
BDBM50091757 CC[C@H](C)[C@@H]1NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)CNC(=O)CNC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](N)CSSC[C@@H](NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)CNC1=O)C(O)=O)[C@@H](C)CC
BDBM50091758 CC[C@H](C)CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)Cc1ccc(NC(=O)c2ccc3ccccc3c2)cc1)[C@@H](C)CC
BDBM50091759 CC[C@H](C)CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)Cc1ccc(NC(=O)c2ccc3ccccc3c2)cc1)[C@@H](C)CC
BDBM50091760 CC[C@H](C)[C@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)Cc1ccc(NC(=O)c2ccc3ccccc3c2)cc1)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O
BDBM50091761 CC[C@H](C)CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)Cc1ccc(NC(=O)c2ccc3ccccc3c2)cc1)[C@@H](C)CC
BDBM50091747 CC[C@H](C)CNC(=O)[C@H](C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)Cc1ccc(NC(=O)c2ccc3ccccc3c2)cc1)[C@@H](C)CC
BDBM50091748 CC[C@H](C)CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)Cc1ccc(NC(=O)c2ccc3ccccc3c2)cc1
BDBM50091749 CC[C@H](C)[C@@H]1NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)CNC(=O)CNC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](N)CSSC[C@@H](NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)CNC1=O)C(O)=O
BDBM50091750 CC[C@H](C)[C@@H]1NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)CNC(=O)CNC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](N)CSSC[C@@H](NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)CNC1=O)C(O)=O)[C@@H](C)CC
BDBM50112323 CC[C@H](C)[C@H]1NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H](CC(O)=O)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CCCNC(N)=N)NC(=O)CNC(=O)CNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)[C@H](CSSC[C@H](NC(=O)[C@H](CO)NC1=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@@H](N)CCSC
BDBM50112324 CC[C@H](C)[C@@H]1NC(=O)[C@@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)CNC(=O)CNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)[C@H](CSSC[C@@H](NC(=O)[C@@H](CO)NC1=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@@H](N)CCSC
BDBM50112325 CC[C@H](C)[C@@H]1NC(=O)[C@@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CCCNC(N)=N)NC(=O)CNC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](Cc2cnc[nH]2)NC(=O)[C@H](CSSC[C@@H](NC(=O)[C@@H](CO)NC1=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@@H](N)CCSC
BDBM50112316 CC[C@H](C)[C@H]1NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H](CC(O)=O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CCCNC(N)=N)NC(=O)CCCNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)[C@H](CSSC[C@H](NC(=O)[C@H](CO)NC1=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCNC(N)=N)C(N)=O)NC(=O)[C@@H](N)CCSC
BDBM50112317 CC[C@H](C)[C@@H]1NC(=O)[C@@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](C)NC(=O)CNC(=O)CNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)[C@H](CSSC[C@@H](NC(=O)[C@@H](CO)NC1=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@@H](N)CCSC
BDBM50112318 CC[C@H](C)[C@@H]1NC(=O)[C@@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H]2CCCN2C(=O)CNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)[C@H](CSSC[C@@H](NC(=O)[C@@H](CO)NC1=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@@H](N)CCSC
BDBM50112326 CC[C@H](C)[C@@H]1NC(=O)[C@@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CCCNC(N)=N)NC(=O)CNC(=O)[C@@H]2CCCN2C(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)[C@H](CSSC[C@@H](NC(=O)[C@@H](CO)NC1=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@@H](N)CCSC
BDBM50112319 CC[C@H](C)[C@@H]1NC(=O)[C@@H](CCCNC(N)=N)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CCSC)NC(=O)[C@H](CCCNC(N)=N)NC(=O)CNC(=O)CNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)[C@H](CSSC[C@@H](NC(=O)[C@@H](CO)NC1=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@@H](N)CCSC
BDBM50112320 CC[C@H](C)[C@@H]1NC(=O)[C@@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](CCSC)NC(=O)[C@@H]2CCCN2C(=O)CNC(=O)CNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)[C@H](CSSC[C@@H](NC(=O)[C@@H](CO)NC1=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@@H](N)CCSC
BDBM50112321 CC[C@H](C)[C@@H]1NC(=O)[C@@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](CCSC)NC(=O)[C@H](CCCNC(N)=N)NC(=O)CNC(=O)CNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)[C@H](CSSC[C@@H](NC(=O)[C@@H](CO)NC1=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@@H](N)CCSC
BDBM50112322 CC[C@H](C)[C@H]1NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H](CC(O)=O)NC(=O)[C@H](CCSC)NC(=O)[C@@H](CCCNC(N)=N)NC(=O)CCNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)[C@H](CSSC[C@H](NC(=O)[C@H](CO)NC1=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@@H](N)CCSC
BDBM50333671 CC[C@H](C)[C@@H]1NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(N)=N)NC(=O)CNC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CSSC[C@H](NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC1=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc1cnc[nH]1)C(O)=O)NC(=O)CNC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](CCSC)NC(=O)[C@H](CCCCN)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CO)C(C)C |r,wU:225.227,208.215,138.139,75.120,83.84,95.96,44.44,35.35,27.27,19.19,122.123,157.158,195.203,185.190,232.236,wD:216.224,204.207,131.132,146.147,59.59,101.102,8.8,4.3,2.2,107.108,113.114,70.180,168.169,(18.37,-46.54,;18.39,-45,;17.06,-44.22,;15.73,-44.98,;17.07,-42.68,;16.28,-41.36,;14.74,-41.36,;13.95,-40.04,;13.97,-42.75,;14.76,-44.07,;13.99,-45.41,;14.78,-46.74,;14.02,-48.07,;14.8,-49.4,;14.05,-50.74,;16.34,-49.38,;12.44,-42.76,;11.66,-41.43,;12.42,-40.09,;10.12,-41.43,;9.36,-40.1,;10.11,-38.77,;11.65,-38.76,;9.34,-37.44,;9.36,-42.77,;7.82,-42.81,;7.08,-44.14,;7.03,-41.47,;6.26,-42.8,;4.72,-42.78,;3.93,-44.11,;4.69,-45.44,;5.49,-41.49,;4.73,-40.23,;5.48,-38.88,;3.21,-40.24,;3.6,-41.73,;2.51,-42.81,;2.89,-44.29,;1.81,-45.37,;2.19,-46.86,;2.44,-41.6,;.96,-41.6,;.19,-42.94,;.19,-40.28,;-.58,-41.61,;-2.12,-41.59,;-2.91,-42.92,;-4.45,-42.9,;-5.22,-44.23,;-6.75,-44.22,;-4.47,-45.57,;-1.35,-40.28,;-2.13,-38.94,;-3.67,-38.96,;-1.38,-37.58,;-2.17,-36.26,;-1.42,-34.92,;-2.21,-33.6,;.03,-34.88,;.78,-33.54,;-.02,-32.22,;.74,-30.87,;-.05,-29.56,;-1.6,-29.58,;-2.35,-30.93,;-1.54,-32.25,;.82,-36.21,;2.39,-36.19,;3.14,-34.85,;3.18,-37.53,;4.72,-37.53,;5.5,-36.18,;7.06,-36.18,;7.85,-34.82,;9.4,-34.82,;10.19,-36.18,;11.67,-36.11,;12.5,-37.4,;12.38,-34.74,;13.91,-34.74,;14.75,-36.06,;14,-37.41,;16.32,-36.07,;17.09,-37.39,;16.31,-38.73,;17.09,-40.06,;14.78,-38.73,;17.09,-34.7,;18.65,-34.71,;19.41,-33.37,;19.44,-36.06,;20.92,-35.99,;21.69,-37.32,;20.93,-38.66,;23.26,-37.31,;24.04,-38.62,;23.28,-39.96,;24.03,-35.97,;25.47,-35.97,;26.24,-34.64,;26.25,-37.29,;27.79,-37.28,;28.57,-38.61,;25.49,-38.63,;26.27,-39.96,;27.81,-39.95,;25.52,-41.34,;26.31,-42.65,;27.85,-42.62,;23.99,-41.37,;23.24,-42.72,;24.04,-44.04,;21.7,-42.76,;20.97,-44.11,;21.77,-45.42,;19.98,-41.05,;18.61,-42.67,;19.39,-43.99,;10.16,-33.48,;9.39,-32.15,;11.71,-33.48,;12.48,-32.13,;11.13,-31.35,;11.14,-29.78,;9.82,-29.01,;9.83,-27.44,;8.52,-26.67,;13.83,-31.36,;15.16,-32.14,;13.84,-29.82,;15.19,-29.05,;16.53,-29.83,;17.86,-29.08,;16.52,-31.4,;15.19,-27.51,;13.87,-26.74,;16.56,-26.74,;16.56,-25.2,;15.25,-24.43,;15.26,-22.87,;13.93,-22.1,;16.62,-22.09,;17.93,-24.44,;19.27,-25.22,;17.94,-22.9,;19.29,-22.13,;20.65,-22.92,;21.98,-22.17,;23.33,-22.96,;24.66,-22.2,;26.01,-22.99,;26,-24.56,;27.34,-22.24,;19.31,-20.6,;17.99,-19.83,;20.67,-19.82,;20.68,-18.3,;19.36,-17.52,;19.37,-15.96,;18.05,-15.19,;18.06,-13.62,;16.74,-12.84,;15.41,-13.6,;16.75,-11.3,;22.04,-17.52,;23.39,-18.32,;22.05,-15.99,;23.41,-15.22,;24.76,-16.01,;26.09,-15.26,;26.28,-13.73,;27.8,-13.43,;28.56,-14.78,;27.51,-15.92,;23.42,-13.69,;24.78,-12.91,;22.1,-12.92,;3.94,-36.18,;4.71,-34.83,;6.25,-34.83,;3.93,-33.49,;4.71,-32.15,;3.93,-30.82,;2.39,-30.82,;4.71,-29.48,;6.25,-29.49,;7.02,-28.15,;3.94,-28.15,;4.71,-26.81,;6.25,-26.81,;3.94,-25.48,;4.71,-24.14,;3.94,-22.81,;2.4,-22.81,;4.71,-21.47,;6.25,-21.47,;7.02,-22.81,;8.56,-22.81,;9.33,-21.48,;9.33,-24.15,;3.94,-20.13,;4.71,-18.79,;6.25,-18.8,;3.94,-17.46,;4.72,-16.12,;3.94,-14.79,;2.4,-14.79,;4.72,-13.44,;6.26,-13.44,;7.02,-14.78,;8.57,-14.79,;9.33,-16.12,;3.95,-12.11,;4.72,-10.78,;6.26,-10.78,;3.95,-9.44,;2.41,-9.44,;1.64,-10.77,;.09,-10.77,;-.68,-12.12,;-2.22,-12.12,;4.73,-8.09,;3.95,-6.78,;2.41,-6.75,;4.65,-5.4,;6.2,-5.39,;6.44,-3.74,;4.94,-2.99,;3.76,-4.19,;2.22,-4.07,;1.35,-5.33,;1.57,-2.67,;.03,-2.56,;2.43,-1.41,;3.96,-1.52,;2.4,-17.46,;1.63,-16.12,;1.63,-18.79,)|
BDBM50228173 [#6]-[#6](-[#6])-[#6]-[#6@H](-[#7]-[#6](=O)-[#6@@H](-[#7])-[#6]-[#8])-[#6](=O)-[#7]-[#6@@H](-[#6]-[#6]-[#6]\[#7]=[#6](\[#7])-[#7])-[#6](=O)-[#7]-[#6@@H](-[#6]-[#6]-[#6]\[#7]=[#6](/[#7])-[#7])-[#6](=O)-[#7]-[#6@@H](-[#6]-[#8])-[#6](=O)-[#7]-[#6@@H](-[#6]-[#8])-[#6](=O)-[#7]-[#6@@H](-[#6]-[#16])-[#6](=O)-[#7]-[#6@@H](-[#6]-c1ccccc1)-[#6](=O)-[#7]-[#6]-[#6](=O)-[#7]-[#6]-[#6](=O)-[#7]-[#6@@H](-[#6]-[#6]-[#6]\[#7]=[#6](\[#7])-[#7])-[#6](-[#8])=O