BindingDB logo
myBDB logout

5 SMILES Strings for Aurora A/TPX2 (1-43)

Compound NameSMILES String
BDBM109206 CCN1\C(=C\C=C\C=C\C2=[N+](CC)c3ccc(cc3C2(C)C)S([O-])(=O)=O)C(C)(CCCC(=O)NCCCC[C@@H](NC(=O)c2ccc(Nc3ncc4CN=C(c5cc(Cl)ccc5-c4n3)c3c(F)cccc3OC)cc2OC)C(N)=O)c2cc(ccc12)S(O)(=O)=O |r,c:9,54|
BDBM109207 [#6]-[#6]-[#7]-1\[#6](=[#6]\[#6]=[#6]\[#6]=[#6]\[#6]2=[#7+](-[#6]-[#6])-c3ccc(cc3C2([#6])[#6])S([#8-])(=O)=O)C([#6])([#6]-[#6]-[#6]-[#6](=O)-[#7]-[#6]-[#6]-[#6]-[#6]-[#6](-[#7]-[#6](=O)-[#6](-[#6]-[#6]-[#6]\[#7+]=[#6](\[#7])-[#7])-[#7]-[#6](=O)-[#6](-[#6]-[#6]-[#6]-[#7]-[#6](-[#7])=[#7+])-[#7]-[#6](=O)-[#6](-[#6]-[#6]-[#6]-[#7]-[#6](-[#7])=[#7+])-[#7]-[#6](=O)-[#6](-[#6]-[#6]-[#6]-[#7]-[#6](-[#7])=[#7+])-[#7]-[#6](=O)-[#6](-[#6]-[#6]-[#6]-[#7]-[#6](-[#7])=[#7+])-[#7]-[#6](=O)-[#6](-[#6]-[#6]-[#6]-[#7]-[#6](-[#7])=[#7+])-[#7]-[#6](-[#6])=O)-[#6](=O)-[#7]-[#6](-[#6]-[#6]-[#6]-[#6]-[#7]-[#6](=O)-c2ccc(-[#7]-c3ncc4-[#6]-[#7]=[#6](-c5cc(Cl)ccc5-c4n3)-c3c(F)cccc3-[#8]-[#6])cc2-[#8]-[#6])-[#6](-[#7])=O)c2cc(ccc-12)S([#8-])(=O)=O |c:9,132|
BDBM109208 CCN1\C(=C\C=C\C=C\C2=[N+](CC)c3ccc(cc3C2(C)C)S([O-])(=O)=O)C(C)(CCCC(=O)NCCCC[C@@H](NC(=O)[C@]2(Cc3cccc(Nc4nccs4)n3)CCC(CC2)Oc2cccc(Cl)c2F)C(N)=O)c2cc(ccc12)S(O)(=O)=O |r,wU:42.43,38.40,wD:42.44,c:9,(-16.27,-52.94,;-14.86,-52.31,;-14.7,-50.78,;-15.85,-49.75,;-17.35,-50.07,;-18.44,-48.98,;-19.93,-49.38,;-21.02,-48.29,;-22.51,-48.69,;-23.6,-47.6,;-25.12,-47.84,;-25.82,-49.22,;-27.36,-49.22,;-25.82,-46.47,;-27.3,-46.07,;-27.7,-44.59,;-26.61,-43.5,;-25.13,-43.89,;-24.73,-45.38,;-23.36,-46.08,;-22.27,-44.99,;-21.87,-46.48,;-27.01,-42.01,;-27.41,-40.52,;-25.52,-41.61,;-28.5,-42.41,;-15.22,-48.34,;-15.22,-46.8,;-16.56,-47.57,;-16.56,-46.03,;-17.89,-45.26,;-17.89,-43.72,;-16.56,-42.95,;-19.22,-42.95,;-19.22,-41.41,;-20.56,-40.64,;-20.56,-39.1,;-21.89,-38.33,;-21.89,-36.79,;-23.22,-36.02,;-23.22,-34.48,;-21.89,-33.71,;-24.56,-33.71,;-24.56,-35.25,;-25.89,-36.02,;-25.89,-37.56,;-27.23,-38.34,;-28.56,-37.57,;-28.56,-36.03,;-29.89,-35.26,;-29.89,-33.72,;-31.14,-32.81,;-30.66,-31.35,;-29.12,-31.35,;-28.65,-32.81,;-27.22,-35.26,;-23.22,-32.94,;-23.22,-31.4,;-24.56,-30.63,;-25.89,-31.4,;-25.89,-32.94,;-24.56,-29.09,;-25.89,-28.32,;-27.22,-29.09,;-28.56,-28.32,;-28.56,-26.78,;-27.22,-26.01,;-27.22,-24.47,;-25.89,-26.78,;-24.56,-26.01,;-20.56,-36.02,;-19.22,-36.79,;-20.56,-34.48,;-13.69,-48.51,;-12.55,-47.48,;-11.08,-47.95,;-10.76,-49.46,;-11.91,-50.49,;-13.37,-50.01,;-9.94,-46.92,;-8.85,-45.83,;-11.03,-45.83,;-8.85,-48.01,)|
BDBM109209 OC(=O)[C@]1(Cc2cccc(Nc3nccs3)n2)CCC(CC1)Oc1cccc(Cl)c1F |r,wU:3.2,wD:3.3,(2.79,-10.07,;2.79,-8.53,;4.12,-7.76,;1.46,-7.76,;1.46,-9.3,;.12,-10.07,;.12,-11.61,;-1.21,-12.38,;-2.54,-11.61,;-2.54,-10.07,;-3.88,-9.3,;-3.88,-7.76,;-5.12,-6.85,;-4.65,-5.39,;-3.11,-5.39,;-2.63,-6.85,;-1.21,-9.3,;2.79,-6.99,;2.79,-5.45,;1.46,-4.68,;.12,-5.45,;.12,-6.99,;1.46,-3.14,;.12,-2.37,;-1.21,-3.14,;-2.54,-2.37,;-2.54,-.83,;-1.21,-.05,;-1.21,1.49,;.12,-.83,;1.46,-.06,)|
BDBM50277545 COc1cc(Nc2ncc3CN=C(c4cc(Cl)ccc4-c3n2)c2c(F)cccc2OC)ccc1C(O)=O |c:11|