BindingDB logo
myBDB logout

26 SMILES Strings for Aurora Kinase A (Aurora-A)

Compound NameSMILES String
BDBM26309 FC(F)(F)c1cccc(c1)C(=O)Nc1ccc(CCNc2ncnc3ccsc23)cc1
BDBM26310 FC(F)(F)c1cccc(NC(=O)c2ccc(CCNc3ncnc4ccsc34)cc2)c1
BDBM26311 FC(F)(F)c1cccc(NC(=O)Nc2ccc(CCNc3ncnc4ccsc34)cc2)c1
BDBM26312 FC(F)(F)c1cccc(NC(=O)Nc2cccc(CCNc3ncnc4ccsc34)c2)c1
BDBM26313 FC(F)(F)c1cccc(NC(=O)Nc2cn(CCNc3ncnc4ccsc34)cn2)c1
BDBM26314 FC(F)(F)c1cccc(NC(=O)Nc2cn(CCNc3ncnc4ccsc34)nn2)c1
BDBM26315 FC(F)(F)c1cccc(NC(=O)Nc2ncc(CCNc3ncnc4ccsc34)s2)c1
BDBM26316 FC(F)(F)c1cccc(NC(=O)Nc2nc(CCNc3ncnc4ccsc34)cs2)c1
BDBM26317 FC(F)(F)c1cccc(c1)C(=O)Nc1ncc(CCNc2ncnc3ccsc23)s1
BDBM26318 FC(F)(F)c1cccc(CC(=O)Nc2ncc(CCNc3ncnc4ccsc34)s2)c1
BDBM26319 FC(F)(F)c1cccc(NC(=O)Cc2ncc(CCNc3ncnc4ccsc34)s2)c1
BDBM26320 O=C(Nc1ncc(CCNc2ncnc3ccsc23)s1)Nc1ccccc1
BDBM26321 CN(C(=O)Nc1ncc(CCNc2ncnc3ccsc23)s1)c1ccccc1
BDBM26322 Cc1cccc(NC(=O)Nc2ncc(CCNc3ncnc4ccsc34)s2)c1
BDBM26323 COc1cccc(NC(=O)Nc2ncc(CCNc3ncnc4ccsc34)s2)c1
BDBM26324 O=C(Nc1ncc(CCNc2ncnc3ccsc23)s1)Nc1cccc(c1)C#C
BDBM26325 Fc1cccc(NC(=O)Nc2ncc(CCNc3ncnc4ccsc34)s2)c1
BDBM26326 Clc1cccc(NC(=O)Nc2ncc(CCNc3ncnc4ccsc34)s2)c1
BDBM26327 Clc1ccc(NC(=O)Nc2ncc(CCNc3ncnc4ccsc34)s2)cc1
BDBM26328 Clc1ccccc1NC(=O)Nc1ncc(CCNc2ncnc3ccsc23)s1
BDBM26329 Clc1ccc(NC(=O)Nc2ncc(CCNc3ncnc4ccsc34)s2)cc1Cl
BDBM26330 Fc1ccc(NC(=O)Nc2ncc(CCNc3ncnc4ccsc34)s2)cc1Cl
BDBM26331 O=C(Nc1ncc(CCNc2ncnc3ccsc23)s1)Nc1cccc2cc[nH]c12
BDBM26332 O=C(NC1CCCCC1)Nc1ncc(CCNc2ncnc3ccsc23)s1
BDBM26333 FC(F)(F)c1cc(CN2CCCC2)cc(NC(=O)Nc2ncc(CCNc3ncnc4ccsc34)s2)c1
BDBM26334 O=C(Nc1ncc(CCNc2ncnc3ccsc23)s1)Nc1cccc(CCN2CCC2)c1