BindingDB logo
myBDB logout

5 SMILES Strings for Autoinducer 1 sensor kinase/phosphatase luxN

Compound NameSMILES String
BDBM50351499 CC(C)OC(=O)CSc1nc2ccccc2[nH]1
BDBM50351500 CC(C)(c1ccccc1)c1ccc(OCC(=O)NC2CCCC2)cc1
BDBM50351501 Clc1ccc(cc1)C(=O)c1ccc(cc1)S(=O)(=O)c1ccc(Cl)cc1
BDBM50351502 COc1ccc(CNC(=O)C(NS(=O)(=O)c2ccc3nc(C)sc3c2)C(C)C)cc1
BDBM50351503 CC(C)CC(NS(=O)(=O)c1ccc2CCN(C(C)=O)c2c1)C(=O)NCc1ccc(Cl)cc1