BindingDB logo
myBDB logout

1 SMILES String for Autotaxin (zATX)

Compound NameSMILES String
BDBM103570 CN(CC(=O)NNS(C)(=O)=O)S(=O)(=O)c1ccc(Cl)cc1