BindingDB logo
myBDB logout

3 SMILES Strings for Avian myoblastosis virus polyprotein II

Compound NameSMILES String
BDBM50181687 Clc1ccc(C=C2SC(=S)N(NS(=O)(=O)c3ccccc3)C2=O)cc1 |w:5.4|
BDBM50212469 Cc1cn(C2CC(N=[N+]=[N-])C(COP(O)(=O)CF)O2)c(=O)[nH]c1=O
BDBM50212470 O[C@@H]1[C@@H](COP(O)(=O)C(F)F)OC([C@@H]1O)n1ccc(=O)[nH]c1=O |r|