BindingDB logo
myBDB logout

4 SMILES Strings for Axin-2

Compound NameSMILES String
BDBM50318567 FC(F)(F)c1ccc(cc1)-c1nc2CCSCc2c(=O)[nH]1
BDBM50380590 COc1ccc(cc1)-c1noc(CSc2nnc(C)n2-c2ccc(OC)cc2)n1
BDBM50380592 COc1ccc(cc1)-n1c(SCc2nc(no2)-c2ccc(C)cc2)nnc1-c1ccncc1
BDBM50380595 COc1ccc(cc1)-n1c(C)nnc1SCc1nc(no1)-c1ccc(OC)c(OC)c1