BindingDB logo
myBDB logout

7 SMILES Strings for B-N-acetylhexosaminidase

Compound NameSMILES String
BDBM50327038 CC1=N[C@H]2[C@H](O[C@H](CO)[C@@H](O)[C@@H]2O)S1 |r,t:1|
BDBM50377440 CC(=O)N[C@@H]1NC[C@H](CO)[C@H](O)[C@@H]1O |r|
BDBM50377441 Cc1nc2[C@@H](O)[C@@H](O)[C@@H](CO)Oc2s1
BDBM50377442 CC1=N[C@@H]2[C@@H](O)[C@@H](O)[C@@H](CO)O[C@]2(CNC(=O)OC(C)(C)C)S1 |t:1|
BDBM50377443 CC1=N[C@@H]2[C@@H](O)[C@@H](O)[C@@H](CO)O[C@]2(CN)S1 |t:1|
BDBM50377444 CC1=N[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@]2(C)S1 |t:1|
BDBM50377445 CC1=N[C@H]2[C@H](O[C@H](CO)[C@H](O)[C@@H]2O)S1 |t:1|