BindingDB logo
myBDB logout

1 SMILES String for B-Raf Protein Kinase Mutant (V599E)

Compound NameSMILES String
BDBM16673 CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(c3)C(F)(F)F)cc2)ccn1