BindingDB logo
myBDB logout

1 SMILES String for BCR/ABL p210 fusion protein

Compound NameSMILES String
BDBM50211223 CN1CCN(Cc2ccc(cc2C(F)(F)F)C(=O)Nc2ccc(C)c(OC3CCN(CC3)C(=O)c3ccc(C)nc3)c2)CC1