BindingDB logo
myBDB logout

14 SMILES Strings for BDBM197287

Compound NameSMILES String
BDBM50055166 CCCCCC[N+](C)(C)C
BDBM50340078 [O-]C(=O)c1ccc(cc1)C#N
BDBM50405324 OC(=O)c1cccc(Cl)c1
BDBM50405318 OC(=O)c1ccc(Cl)cc1
BDBM197313 C[N+](C)(C)CCc1ccccc1
BDBM197311 [O-]C(=O)CCCC#N
BDBM197314 [O-]C(=O)c1cccc(c1)[N+]([O-])=O
BDBM197302 OC(=O)c1ccccc1
BDBM197303 Cc1ccc(cc1)C(O)=O
BDBM197304 CCc1ccc(cc1)C(O)=O
BDBM197305 OC(=O)C1CCCCC1
BDBM197306 C[C@H]1CC[C@@H](CC1)C(O)=O |r,wU:4.7,wD:1.0,(-11.11,-3.91,;-11.11,-2.37,;-9.78,-1.6,;-9.78,-.06,;-11.11,.72,;-12.44,-.06,;-12.44,-1.6,;-11.11,2.26,;-9.78,3.03,;-12.44,3.03,)|
BDBM197307 OC(=O)C1CCCC1
BDBM197308 OC(=O)C1CCCCCC1