BindingDB logo
myBDB logout

5 SMILES Strings for BDBM197309

Compound NameSMILES String
BDBM50055166 CCCCCC[N+](C)(C)C
BDBM50340078 [O-]C(=O)c1ccc(cc1)C#N
BDBM197313 C[N+](C)(C)CCc1ccccc1
BDBM197311 [O-]C(=O)CCCC#N
BDBM197314 [O-]C(=O)c1cccc(c1)[N+]([O-])=O