BindingDB logo
myBDB logout

11 SMILES Strings for BDBM197310

Compound NameSMILES String
BDBM50241464 COc1cc2CCN(CCc3ccc(NC(=O)c4ccc(N)cc4)cc3)Cc2cc1OC
BDBM50241461 CN(C)c1ccc2nc3ccc(cc3sc2c1)=[N+](C)C |(17.73,-40.24,;19.06,-41.01,;19.06,-42.55,;20.39,-40.24,;20.4,-38.7,;21.73,-37.93,;23.06,-38.69,;24.39,-37.91,;25.73,-38.69,;27.06,-37.93,;28.39,-38.69,;28.39,-40.23,;27.06,-41,;25.73,-40.23,;24.39,-41.01,;23.06,-40.24,;21.73,-41.01,;29.73,-41,;29.73,-42.54,;31.06,-40.23,)|
BDBM197315 [NH3+]CCCC[NH3+]
BDBM197316 [NH3+]CCC[NH2+]CCCC[NH2+]CCC[NH3+]
BDBM197317 Nc1ccc2cc3ccc(N)cc3[nH+]c2c1
BDBM197318 CN(C)c1ccc2cc3ccc(cc3[nH+]c2c1)N(C)C
BDBM197320 [O-]C(=O)CCn1c(=O)c2ccc3c4c(ccc(c24)c1=O)c(=O)n(CCC([O-])=O)c3=O
BDBM197319 C[NH+](C)CCn1c(=O)c2ccc3c4c(ccc(c24)c1=O)c(=O)n(CC[NH+](C)C)c3=O
BDBM197321 [#6]-[#6]-[#7](-[#6]-[#6])-c1ccc(cc1)-[#6](=[#6]-1/[#6]=[#6]\[#6](\[#6]=[#6]-1)=[#7+](/[#6]-[#6])-[#6]-[#6])\c1ccccc1 |c:14,17|
BDBM197322 Cc1cc2nc3ccc(cc3[nH]c2cc1N)=[N+](C)C |(-8.62,.06,;-7.29,-.71,;-5.95,.06,;-4.62,-.71,;-3.29,.06,;-1.95,-.71,;-.62,.06,;.71,-.71,;.71,-2.26,;-.62,-3.03,;-1.95,-2.25,;-3.29,-3.02,;-4.62,-2.25,;-5.95,-3.02,;-7.29,-2.25,;-8.62,-3.02,;2.05,-3.03,;2.05,-4.57,;3.38,-2.26,)|
BDBM197288 [NH3+]Cc1ccc(C[NH3+])cc1