BindingDB logo
myBDB logout

2 SMILES Strings for Bacterial beta-lactamase TEM

Compound NameSMILES String
BDBM50021954 CC1(C)[C@@H](N2[C@@H](CC2=O)S1(=O)=O)C(O)=O |r|
BDBM50021956 C[C@]1(Cn2ccnn2)[C@@H](C2C(CC2=O)S1(=O)=O)C([O-])=O