BindingDB logo
myBDB logout

9 SMILES Strings for Bacteriophage T4 DNA Ligase

Compound NameSMILES String
BDBM22981 CCOC(=O)CC(C1O[C@H]2OC(C)(C)O[C@H]2[C@@H]1OCc1ccccc1)N(Cc1ccccc1)C(=O)Nc1ccc(Cl)cc1 |r|
BDBM22982 CCOC(=O)CC(NC(=S)NC(=O)c1ccccc1)C1O[C@H]2OC(C)(C)O[C@H]2[C@@H]1OCc1ccccc1 |r|
BDBM22983 CCOC(=O)CC(NC(=O)Nc1cccc(NC(=O)NC(CC(=O)OCC)C2O[C@H]3OC(C)(C)O[C@H]3[C@@H]2OCc2ccccc2)c1)C1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |r|
BDBM22984 COc1cccc2C(=O)c3c(O)c4C[C@](O)(C[C@H](O[C@H]5C[C@H](N)[C@H](O)[C@H](C)O5)c4c(O)c3C(=O)c12)C(=O)CO |r|
BDBM22985 CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12
BDBM22986 C(CCCn1c-2c(CCSc3ccccc-23)c2ccccc12)CCN1CCCCC1
BDBM50008923 CC[C@@]1(O)C(=O)OCc2c1cc1-c3nc4ccccc4cc3Cn1c2=O |r|
BDBM50164888 Oc1ccc(\C=C2\C(=O)Oc3cc(O)ccc23)cc1
BDBM50242374 CCCCCCCC(C)CC=C(C)C=CC(=O)C(C)CCC1OC(=O)[C@H](CC(OS(O)(=O)=O)C(N)=O)NC(=O)[C@@H](C)CNC(=O)C(=C)NC(=O)C1C |r,w:14.14,10.9|