BindingDB logo
myBDB logout

14 SMILES Strings for Baculoviral IAP repeat (BIR) domains BIR3

Compound NameSMILES String
BDBM228590 CN[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@H](CNC(=O)c2ccccc2)Cc2cccnc12
BDBM228591 CN[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@H](CNC(C)=O)Cc2cccnc12
BDBM228592 CN[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@H](CNC(=O)NC)Cc2cccnc12
BDBM228593 CN[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@H](CNC(=O)Cc2ccccc2)Cc2cccnc12
BDBM228594 CN[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@H](CNC(=O)OC)Cc2cccnc12
BDBM228595 CN[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@H](CNC(=O)N(C)C)Cc2cccnc12
BDBM228596 CN[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@H](CNC(=O)Nc2ccccc2)Cc2cccnc12
BDBM228597 CN[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@H](CNC(=O)[C@@H](C)c2ccccc2)Cc2cccnc12
BDBM228598 CN[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@H](CNS(C)(=O)=O)Cc2cccnc12
BDBM228599 CN[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@H](CNS(=O)(=O)c2ccccc2)Cc2cccnc12
BDBM228600 CN[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@H](CNC(=O)OCc2ccccc2)Cc2cccnc12
BDBM228601 CN[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@H](CNC(=O)Oc2ccccc2)Cc2cccnc12
BDBM228602 CN[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@H](CNc2ccccc2)Cc2cccnc12
BDBM228603 CN[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@H](CNc2ccc3ccccc3c2)Cc2cccnc12