BindingDB logo
myBDB logout

33 SMILES Strings for Baculoviral IAP repeat-containing protein 5

Compound NameSMILES String
BDBM26673 Oc1ccc(Br)cc1-c1cc(-c2ccccc2)c(C#N)c(=O)[nH]1
BDBM50209180 Oc1ccc(Br)cc1-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1
BDBM50209181 Brc1cccc(c1)-c1cnc2ccccc2c1
BDBM50209182 CN(Cc1cc(Cl)cc(c1O)-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1)C(=O)C1CCN(CC1)C(=O)C1CCCCC1
BDBM50209183 CCCCCN1CCC(CC1)C(=O)N(C)Cc1cc(Cl)cc(c1O)-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1
BDBM50209184 CC(C)Cc1ccc(O)c(c1)-c1cc(-c2cc(Cl)ccc2Cl)c(C#N)c(=O)[nH]1
BDBM50209185 Oc1ccc(Cl)cc1-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1
BDBM50209186 Clc1ccc(cc1)-n1ccc2ccccc12
BDBM50209187 CN(Cc1cc(Cl)cc(c1O)-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1)C(=O)CCN1CCCC1
BDBM50209188 Oc1ccccc1-c1cc(-c2ccccc2)c(C#N)c(=O)[nH]1
BDBM50209190 CCCC(=O)N1CCC(CC1)C(=O)N(C)Cc1cc(Cl)cc(c1O)-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1
BDBM50209191 Oc1ccc(cc1-c1cc(-c2cc(Cl)ccc2Cl)c(C#N)c(=O)[nH]1)C1CCCC1
BDBM50209192 Cc1ccc(C)c(c1)-c1cc([nH]c(=O)c1C#N)-c1cc(Br)ccc1O
BDBM50209193 COCC(=O)N1CCC(CC1)C(=O)N(C)Cc1cc(Cl)cc(c1O)-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1
BDBM50209194 CCCN1CCC(CC1)C(=O)N(C)Cc1cc(Cl)cc(c1O)-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1
BDBM50209195 Oc1ccc(cc1-c1cc(-c2cc(Cl)ccc2Cl)c(C#N)c(=O)[nH]1)-c1ccccc1
BDBM50209196 Oc1ccc(Br)cc1-c1cc(-c2cc(ccc2Cl)-c2ccccc2)c(C#N)c(=O)[nH]1
BDBM50209197 Oc1ccc(cc1-c1cc(-c2cc(Cl)ccc2Cl)c(C#N)c(=O)[nH]1)C1CCCCC1
BDBM50209198 COC1CCC(CC1)C(=O)N(C)Cc1cc(Cl)cc(c1O)-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1 |(1.17,-33.82,;-.16,-33.05,;-1.49,-33.82,;-1.5,-35.36,;-2.83,-36.13,;-4.16,-35.36,;-4.17,-33.82,;-2.83,-33.05,;-5.49,-36.14,;-6.82,-35.37,;-5.48,-37.68,;-4.15,-38.44,;-6.81,-38.45,;-6.81,-39.99,;-8.14,-40.76,;-8.14,-42.31,;-9.47,-43.08,;-6.81,-43.08,;-5.47,-42.31,;-5.47,-40.76,;-4.14,-39.98,;-4.13,-43.07,;-4.14,-44.62,;-2.81,-45.38,;-2.81,-46.92,;-1.47,-47.68,;-1.46,-49.21,;-2.8,-49.99,;-4.14,-49.22,;-4.14,-47.69,;-5.47,-46.91,;-.13,-49.98,;1.2,-50.74,;.64,-48.64,;-.88,-51.32,;-1.47,-44.61,;-.14,-45.38,;1.19,-46.15,;-1.48,-43.06,;-.15,-42.29,;-2.81,-42.3,)|
BDBM50209199 Cc1ccc(c(C)c1)-c1cc([nH]c(=O)c1C#N)-c1cc(Br)ccc1O
BDBM50209201 CC(=O)N1CCC(CC1)C(=O)NCc1cc(Cl)cc(c1O)-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1
BDBM50209202 Oc1c(CNC(=O)C2CCCCC2)cc(Cl)cc1-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1
BDBM50209203 CN(Cc1cc(Cl)cc(c1O)-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1)C(=O)C1CCCCC1
BDBM50209204 CN(Cc1cc(Cl)cc(c1O)-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1)C(=O)CCN1CCOCC1
BDBM50209205 Cc1ccnc(NC(=O)C2CCNCC2)c1
BDBM50209206 CCc1oc2ccccc2c1C(=O)c1cc(I)c(O)c(I)c1
BDBM50209207 CN(Cc1cc(Cl)cc(c1O)-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1)C(=O)C1CCN(CC1)C(=O)OC(C)(C)C
BDBM50209208 CN(Cc1cc(Cl)cc(c1O)-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1)C(=O)C1CCN(CC1)C(C)=O
BDBM50209209 Oc1ccc(Br)cc1-c1cc(-c2cc(Cl)ccc2Cl)c(C#N)c(=O)[nH]1
BDBM50209210 CN(Cc1cc(Cl)cc(c1O)-c1cc(-c2cc(ccc2Cl)C(F)(F)F)c(C#N)c(=O)[nH]1)C(=O)C1CCNCC1
BDBM50442671 CCN(CC)CCOc1ccc(CCCCc2ccc(OCCN(CC)CC)c(OCCN(CC)CC)c2)cc1OCCN(CC)CC
BDBM50024761 CC1(C)NC(=O)N(C\C(COc2ccc(cc2)-c2ccc(OC(F)(F)F)cc2)=N\O)C1=O
BDBM50024762 Clc1cccc(Nc2ccc3ccccc3c2)c1