BindingDB logo
myBDB logout

9 SMILES Strings for Bcr/Abl fusion protein

Compound NameSMILES String
BDBM50155557 CCN(CC)c1ccc(NC(=O)Nc2ccc(C)c(Nc3nccc(n3)-c3cccnc3)c2)cc1
BDBM50155559 CN(C)c1ccc(NC(=O)Nc2ccc(C)c(Nc3nccc(n3)-c3cccnc3)c2)cc1
BDBM50155560 Cc1ccc(NC(=O)Nc2cccc(Cl)c2)cc1Nc1nccc(n1)-c1cccnc1
BDBM50155561 CN1CCN(CC1)C(=O)Nc1ccc(C)c(Nc2nccc(n2)-c2cccnc2)c1
BDBM50155562 Cc1ccc(NC(=O)Nc2cccc(c2)N2CCCC2)cc1Nc1nccc(n1)-c1cccnc1
BDBM50155565 Cc1ccc(NC(=O)N2CCCCC2)cc1Nc1nccc(n1)-c1cccnc1
BDBM50155567 CN(C)c1cccc(NC(=O)Nc2ccc(C)c(Nc3nccc(n3)-c3cccnc3)c2)c1
BDBM50155568 CCN(CC)c1cccc(NC(=O)Nc2ccc(C)c(Nc3nccc(n3)-c3cccnc3)c2)c1
BDBM50155575 Cc1ccc(NC(=O)NCCN2CCCC2)cc1Nc1nccc(n1)-c1cccnc1