BindingDB logo
myBDB logout

27 SMILES Strings for Bcr-Abl

Compound NameSMILES String
BDBM111448 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)Nc1ccc(F)c(Cl)c1
BDBM111449 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)Nc1cccc(c1)C(F)(F)F
BDBM111450 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)Nc1ccc(Cl)c(Cl)c1
BDBM111451 COc1ccc(NC(=O)c2ccc(C)c(Nc3nccc(n3)-c3cccnc3)c2)cc1
BDBM111452 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)Nc1ccc(Br)cc1
BDBM111453 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)Nc1ccccc1F
BDBM111454 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)Nc1cccc(F)c1
BDBM111455 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)Nc1cc(cc(c1)C(F)(F)F)C(F)(F)F
BDBM111456 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)Nc1cc(Br)cc(c1)C(F)(F)F
BDBM111457 Cc1ccc(NC(=O)c2ccc(C)c(Nc3nccc(n3)-c3cccnc3)c2)cc1
BDBM111459 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)Nc1c(C)cccc1C
BDBM111460 COCc1cccc(NC(=O)c2ccc(C)c(Nc3nccc(n3)-c3cccnc3)c2)c1
BDBM111461 COc1cccc(NC(=O)c2ccc(C)c(Nc3nccc(n3)-c3cccnc3)c2)c1
BDBM111462 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)NCc1ccncc1
BDBM111463 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)NCc1cccnc1
BDBM111464 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)NCc1ccccn1
BDBM111465 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)NCc1ccc(Cl)cn1
BDBM111466 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)NCc1ncccn1
BDBM111467 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)NCc1nccs1
BDBM111468 CN(C)CCCOc1ccc(NC(=O)c2ccc(C)c(Nc3nccc(n3)-c3cccnc3)c2)cc1
BDBM111469 CN(C)CCCCOc1ccc(NC(=O)c2ccc(C)c(Nc3nccc(n3)-c3cccnc3)c2)cc1
BDBM111470 CCN(CC)CCCOc1ccc(NC(=O)c2ccc(C)c(Nc3nccc(n3)-c3cccnc3)c2)cc1
BDBM111471 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)Nc1ccc(OCCCN2CCCC2)cc1
BDBM111472 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)Nc1ccc(OCCCN2CCCCC2)cc1
BDBM111473 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)Nc1ccc(OCCCN2CCOCC2)cc1
BDBM111474 Cc1ccc(cc1Nc1nccc(n1)-c1cccnc1)C(=O)Nc1ccc(OCCCCN2CCOCC2)cc1
BDBM50237710 Cc1cn(cn1)-c1cc(NC(=O)c2ccc(C)c(Nc3nccc(n3)-c3cccnc3)c2)cc(c1)C(F)(F)F