BindingDB logo
myBDB logout

17 SMILES Strings for Beta-1,3-glucan synthase

Compound NameSMILES String
BDBM50327025 CCCCCCCCOc1ccc(NC(=O)C(CCCN)NC(=O)[C@@]2(O)C[C@@H](O)[C@H](O)[C@H](O)C2)cc1 |r,wU:24.23,27.27,wD:24.24,31.31,29.29,(11.11,-33.82,;9.57,-33.82,;8.81,-35.15,;7.28,-35.15,;6.52,-36.48,;4.99,-36.48,;4.22,-37.81,;2.69,-37.81,;1.94,-39.14,;1.94,-40.68,;.61,-41.46,;.61,-43,;1.94,-43.77,;1.94,-45.31,;3.28,-46.08,;3.28,-47.62,;4.61,-45.31,;4.61,-43.77,;5.95,-43,;5.95,-41.46,;7.28,-40.69,;5.94,-46.08,;5.94,-47.62,;4.61,-48.39,;7.28,-48.39,;7.26,-46.85,;8.6,-47.61,;9.94,-48.39,;11.27,-47.63,;9.93,-49.93,;11.26,-50.71,;8.59,-50.7,;8.59,-52.24,;7.27,-49.93,;3.28,-43,;3.28,-41.45,)|
BDBM50327026 CCCCCCCCOc1ccc(NC(=O)[C@@]2(O)C[C@@H](O)[C@H](O)[C@H](O)C2)cc1 |r,wU:19.19,16.15,wD:16.16,23.23,21.21,(.67,7.39,;-.87,7.39,;-1.63,6.06,;-3.17,6.06,;-3.93,4.73,;-5.47,4.73,;-6.23,3.39,;-7.77,3.39,;-8.52,2.05,;-8.52,.51,;-9.85,-.27,;-9.85,-1.81,;-8.52,-2.59,;-8.52,-4.13,;-7.18,-4.9,;-7.18,-6.45,;-5.84,-4.13,;-5.86,-2.58,;-4.51,-3.35,;-3.18,-4.13,;-1.84,-3.36,;-3.18,-5.68,;-1.85,-6.45,;-4.52,-6.44,;-4.53,-7.99,;-5.85,-5.67,;-7.18,-1.81,;-7.18,-.26,)|
BDBM50327027 CCCCCCCCOc1ccc(NC(=O)C(NC(=O)[C@@]2(O)C[C@@H](O)[C@H](O)[C@H](O)C2)C(C)O)cc1 |r,wU:20.19,23.23,wD:20.20,27.27,25.25,(14.12,7.72,;12.59,7.72,;11.82,6.39,;10.29,6.39,;9.53,5.06,;8,5.06,;7.23,3.73,;5.7,3.73,;4.95,2.39,;4.95,.85,;3.62,.08,;3.62,-1.47,;4.95,-2.24,;4.95,-3.78,;6.29,-4.55,;6.29,-6.09,;7.62,-3.78,;8.96,-4.55,;8.95,-6.09,;7.62,-6.86,;10.29,-6.86,;10.28,-5.31,;11.61,-6.08,;12.95,-6.86,;14.28,-6.09,;12.94,-8.4,;14.27,-9.18,;11.6,-9.16,;11.6,-10.7,;10.28,-8.39,;7.62,-2.24,;6.84,-.89,;8.96,-1.47,;6.29,-1.47,;6.29,.08,)|
BDBM50327028 CCCCCCCCOc1ccc(NC(=O)C(CC(O)=O)NC(=O)[C@@]2(O)C[C@@H](O)[C@H](O)[C@H](O)C2)cc1 |r,wU:24.23,27.27,wD:24.24,31.31,29.29,(29.08,7.77,;27.54,7.77,;26.78,6.44,;25.25,6.44,;24.49,5.11,;22.95,5.11,;22.19,3.78,;20.66,3.78,;19.9,2.44,;19.91,.9,;18.58,.13,;18.58,-1.41,;19.91,-2.18,;19.91,-3.72,;21.25,-4.49,;21.24,-6.03,;22.58,-3.72,;22.58,-2.18,;23.91,-1.41,;23.91,.13,;25.25,-2.18,;23.91,-4.49,;23.91,-6.03,;22.58,-6.8,;25.25,-6.8,;25.23,-5.26,;26.57,-6.03,;27.9,-6.8,;29.24,-6.04,;27.9,-8.35,;29.23,-9.12,;26.56,-9.11,;26.56,-10.65,;25.24,-8.34,;21.25,-1.41,;21.24,.14,)|
BDBM50327029 CCCCCCCCOc1ccc(NC(=O)C(CCCN)NC(=O)\C=C\c2ccc(O)c(O)c2)cc1
BDBM50327030 CCCCCCCCOc1ccc(NC(=O)\C=C\c2ccc(O)c(O)c2)cc1
BDBM50327031 CCCCCCCCOc1ccc(NC(=O)C(NC(=O)\C=C\c2ccc(O)c(O)c2)C(C)O)cc1
BDBM50327032 CCCCCCCCOc1ccc(NC(=O)C(CC(O)=O)NC(=O)\C=C\c2ccc(O)c(O)c2)cc1
BDBM50327033 CCCCCCCCOc1ccc(NC(=O)C(CCCNC(=O)OC(C)(C)C)NC(=O)C=Cc2ccc(O)c(O)c2)cc1 |w:31.30|
BDBM50327034 CCCCCCCCOc1ccc(NC(=O)C(NC(=O)\C=C\c2ccc(O)c(O)c2)C(C)OC(C)(C)C)cc1
BDBM50327035 CCCCCCCCOc1ccc(NC(=O)C(CC(=O)OC(C)(C)C)NC(=O)\C=C\c2ccc(O)c(O)c2)cc1
BDBM50327036 O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C\c2ccc(O)c(O)c2)[C@@H]1O)C(O)=O |r|
BDBM50327037 CCCCCCCCCCCCCCCC(=O)N[C@H]1C[C@@H](O)[C@@H](O)NC(=O)[C@@H]2[C@@H](O)[C@@H](C)CN2C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC1=O)[C@@H](C)O)[C@H](O)[C@@H](O)c1ccc(O)cc1)[C@@H](C)O |r|
BDBM50327021 CCCCCCCCOc1ccc(NC(=O)C(CCCN)NC(=O)[C@]2(O)C[C@@H](O)[C@@H](O)[C@@H](C2)OC(=O)\C=C\c2ccc(O)c(O)c2)cc1 |w:16.16|
BDBM50327022 CCCCCCCCOc1ccc(NC(=O)[C@]2(O)C[C@@H](O)[C@@H](O)[C@@H](C2)OC(=O)\C=C\c2ccc(O)c(O)c2)cc1
BDBM50327023 CCCCCCCCOc1ccc(NC(=O)C(NC(=O)[C@]2(O)C[C@@H](O)[C@@H](O)[C@@H](C2)OC(=O)\C=C\c2ccc(O)c(O)c2)C(C)O)cc1 |w:16.16,42.45|
BDBM50327024 CCCCCCCCOc1ccc(NC(=O)C(CC(O)=O)NC(=O)[C@]2(O)C[C@@H](O)[C@@H](O)[C@@H](C2)OC(=O)\C=C\c2ccc(O)c(O)c2)cc1 |w:16.16|