BindingDB logo
myBDB logout

9 SMILES Strings for Beta-1,4-galactosyltransferase 1

Compound NameSMILES String
BDBM50173721 CN(C)c1cccc2c(cccc12)S(=O)(=O)NCCCOC1OC(CO)C(O)C(O)C1NC(C)=O
BDBM50324492 O[C@@H]1[C@@H](COP(O)(=O)OP(O)(=O)O[C@H]2O[C@H](COCCOCCOCCOCc3ccc4ccccc4c3)[C@H](O)[C@H](O)[C@H]2O)O[C@H]([C@@H]1O)n1ccc(=O)[nH]c1=O |r|
BDBM50370674 OC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)c2cc(=O)[nH]c(=O)[nH]2)[C@H](O)[C@@H](O)[C@H]1O |r|
BDBM50370675 OC[C@@H]1O[C@H](OP(O)(=O)OP(O)(=O)OC[C@H]2OC([C@H](O)[C@@H]2O)n2ccc(=O)[nH]c2=O)[C@@H](OCCOCCOCCOCc2ccc3ccccc3c2)[C@@H](O)[C@H]1O |r|
BDBM50370676 O[C@@H]1[C@@H](COP(O)(=O)OP(O)(=O)O[C@H]2O[C@@H](COCCOCCOCCOCc3ccc4ccccc4c3)[C@H](O)[C@H](O)[C@@H]2O)OC([C@@H]1O)n1ccc(=O)[nH]c1=O |r|
BDBM50370677 Cc1ccc2ccc(COC(=O)COCCOCC(=O)NC[C@@H]3O[C@H](OP(O)(=O)OP(O)(=O)OC[C@H]4OC([C@H](O)[C@@H]4O)n4ccc(=O)[nH]c4=O)[C@@H](O)[C@@H](O)[C@H]3O)cc2c1 |r|
BDBM50370678 O[C@@H]1[C@@H](COP(O)(=O)OP(O)(=O)O[C@H]2O[C@@H](CNNC(=O)COCCOCCOCc3ccc4ccccc4c3)[C@H](O)[C@H](O)[C@@H]2O)OC([C@@H]1O)n1ccc(=O)[nH]c1=O |r|
BDBM50370679 COCCOCCOCCOC[C@@H]1O[C@H](OP(O)(=O)OP(O)(=O)OC[C@H]2OC([C@H](O)[C@@H]2O)n2ccc(=O)[nH]c2=O)[C@@H](O)[C@@H](O)[C@H]1O |r|
BDBM50427121 C[n+]1ccn(CCCCCCCCCCCCCCCCCCCCn2cc[n+](C)c2)c1