BindingDB logo
myBDB logout

15 SMILES Strings for Beta-1,4-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase

Compound NameSMILES String
BDBM50433269 CC[C@]1(C)NC(=O)c2cc(ccc2NC1=O)S(=O)(=O)Nc1ccc(F)cc1F |r|
BDBM50433272 CCC1(C)NC(=O)c2cc(ccc2NC1=O)S(=O)(=O)Nc1ccc(Cl)cc1
BDBM50433273 CCC1(C)NC(=O)c2cc(ccc2NC1=O)S(=O)(=O)Nc1ccccc1
BDBM50433274 CC[C@]1(C)NC(=O)c2cc(ccc2NC1=O)S(=O)(=O)Nc1ccc(OC(F)F)cc1 |r|
BDBM50090510 CC(=O)Nc1cc(cc2CCN(CCc3ccccc3)c12)S(=O)(=O)Nc1ccc(F)cc1F
BDBM50117659 COc1cccc(CC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)NCCc2cccc(F)c2)c1
BDBM50117661 COc1cccc(CC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)Nc2cnn(C)n2)c1
BDBM50117667 COc1cccc(CC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)Nc2cnn(n2)C2CCCOC2)c1
BDBM50117660 COc1cccc(CC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)N(C)CCc2cccc(F)c2)c1
BDBM50117662 COc1cccc(CC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)Nc2cnn(n2)-c2ccccc2)c1
BDBM50117663 COc1cccc(CC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)Nc2cnn(n2)-c2ccc(F)cc2)c1
BDBM50117664 COc1cccc(CC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)Nc2cnn(n2)C(C)C)c1
BDBM50117665 COc1cccc(CC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)Nc2cnn(n2)C2CCC2)c1
BDBM50117666 COc1cccc(CC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)Nc2cnn(n2)C2COC2)c1
BDBM50117668 COc1cccc(CC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)Nc2cnn(n2)C2CC(F)(F)C2)c1