BindingDB logo
myBDB logout

3 SMILES Strings for Beta-N-acetyl-D-hexosaminidase-A/B

Compound NameSMILES String
BDBM18512 CCc1nc(N)nc(N)c1-c1ccc(Cl)cc1
BDBM50190644 [H][C@]12CS\C(=N/CCCCCCCC)N1C[C@H](NC(C)=O)[C@H](O)[C@@H]2O |r|
BDBM50190645 [H][C@]12CS\C(=N/c3ccccc3)N1C[C@H](NC(C)=O)[C@H](O)[C@@H]2O |r|