BindingDB logo
myBDB logout

22 SMILES Strings for Beta-adrenergic receptor

Compound NameSMILES String
BDBM25749 CC(C)NCC(O)COc1ccc(NC(C)=O)cc1
BDBM50010550 C[C@@H](CCCCC(=O)Nc1ccc(cc1)C(F)(F)F)NC[C@H](O)COc1ccc(NC(C)=O)cc1
BDBM50010551 C[C@@H](CCCCC(=O)Nc1ccc(C)cc1)NC[C@H](O)COc1cccc2ccccc12
BDBM50010552 CC(CCCCC(=O)Nc1ccc(C)cc1)NCC(O)COc1cccc2ccccc12
BDBM50010553 C[C@H](CCCCC(=O)Nc1ccc(cc1)C(F)(F)F)NC[C@@H](O)COc1ccc(NC(C)=O)cc1
BDBM50010554 C[C@@H](CCCCC(=O)Nc1ccc(C)cc1)NC[C@H](O)COc1ccc(NC(C)=O)cc1
BDBM50010555 C[C@H](CCCCC(=O)Nc1ccc(cc1)C(F)(F)F)NC[C@H](O)COc1ccc(NC(C)=O)cc1
BDBM50010556 C[C@@H](CCCCC(=O)Nc1ccc(C)cc1)NC[C@@H](O)COc1cccc2ccccc12
BDBM50010557 C[C@@H](CCCCC(=O)Nc1ccc(cc1)C(F)(F)F)NC[C@@H](O)COc1ccc(NC(C)=O)cc1
BDBM50010558 C[C@@H](CCCCC(=O)Nc1ccc(C)cc1)NC[C@@H](O)COc1ccc(NC(C)=O)cc1
BDBM50010559 C[C@@H](CCCCC(=O)Nc1ccc(cc1)C(F)(F)F)NC[C@H](O)COc1cccc2ccccc12
BDBM50010560 C[C@H](CCCCC(=O)Nc1ccc(C)cc1)NC[C@@H](O)COc1ccc(NC(C)=O)cc1
BDBM50010561 C[C@H](CCCCC(=O)Nc1ccc(cc1)C(F)(F)F)NC[C@H](O)COc1cccc2ccccc12
BDBM50010562 CC(CCCCC(=O)Nc1ccc(cc1)C(F)(F)F)NCC(O)COc1ccc(NC(C)=O)cc1
BDBM50010563 C[C@H](CCCCC(=O)Nc1ccc(C)cc1)NC[C@@H](O)COc1cccc2ccccc12
BDBM50010564 C[C@H](CCCCC(=O)Nc1ccc(C)cc1)NC[C@H](O)COc1ccc(NC(C)=O)cc1
BDBM50010565 CC(CCCCC(=O)Nc1ccc(C)cc1)NCC(O)COc1ccc(NC(C)=O)cc1
BDBM50010566 C[C@H](CCCCC(=O)Nc1ccc(cc1)C(F)(F)F)NC[C@@H](O)COc1cccc2ccccc12
BDBM50010567 C[C@H](CCCCC(=O)Nc1ccc(C)cc1)NC[C@H](O)COc1cccc2ccccc12
BDBM50010568 CC(CCCCC(=O)Nc1ccc(cc1)C(F)(F)F)NCC(O)COc1cccc2ccccc12
BDBM50010569 C[C@@H](CCCCC(=O)Nc1ccc(cc1)C(F)(F)F)NC[C@@H](O)COc1cccc2ccccc12
BDBM50106829 CS(=O)(=O)Nc1cc(ccc1O)[C@@H](O)CN[C@H](Cc1ccccc1)c1ccc(OC(F)F)cc1